.. _appendix-linear-algebra: ============================================ Appendix B: Linear Algebra for Data Science ============================================ From Notation to Intuition ---------------------------- Linear algebra is the language of modern statistics and data science. Every dataset is a matrix, every model parameter is a vector, and every inference procedure β€” from ordinary least squares to MCMC β€” is a sequence of matrix operations. Yet students often arrive with linear algebra as a collection of mechanical rules (multiply rows by columns, compute determinants by cofactor expansion) without the geometric intuition that makes statistical applications natural. This appendix bridges that gap. We develop the linear algebra prerequisites for this course with emphasis on *why* each concept matters for statistical computation, not just *what* the formulas are. The goal is to build the geometric reasoning that lets you read a matrix expression like :math:`\mathbf{H} = \mathbf{X}(\mathbf{X}^\top\mathbf{X})^{-1}\mathbf{X}^\top` and immediately see a projection β€” the operation that finds the closest point in a subspace to a given vector, which is precisely what least squares does. .. admonition:: Road Map 🧭 :class: important **Foundations**: Vectors, matrices, and the operations that connect them β€” with emphasis on the properties that matter for statistics **Structure**: Special matrix types (symmetric, positive definite, idempotent, stochastic) that arise naturally in statistical models **Blocks**: Partitioned matrices, the Schur complement, and the Sherman-Morrison-Woodbury formula β€” tools for working with structured problems **Geometry**: Column spaces, projections, and the hat matrix β€” the geometric engine behind least squares **Decompositions**: Eigen, Cholesky, QR, and SVD β€” each revealing different structure in data and models **Covariance**: Quadratic forms and covariance matrices β€” how variance propagates through linear transformations via :math:`\text{Var}(\mathbf{A}\mathbf{X}) = \mathbf{A}\text{Var}(\mathbf{X})\mathbf{A}^\top` **Calculus**: Gradients of scalar functions of vectors and matrices β€” the foundation for optimization-based inference **Computation**: Numerical considerations β€” condition numbers, when to avoid forming :math:`\mathbf{X}^\top\mathbf{X}`, and why decompositions beat direct inversion .. admonition:: Prerequisites Check βœ“ :class: tip Before proceeding, ensure you're comfortable with: * Systems of linear equations and their solution * The concept of a function and composition of functions * Basic calculus (derivatives, partial derivatives) * Python basics and NumPy arrays .. admonition:: Connection to Course Material πŸ—ΊοΈ :class: important This appendix supports specific course content: * **Chapter 2** (Monte Carlo): Cholesky decomposition for generating correlated random vectors (:ref:`ch2.4-transformation-methods`) * **Chapter 3** (Parametric Inference): Hat matrix, projections, QR decomposition in linear models (:ref:`ch3_4-linear-models`); Fisher information matrices (:ref:`ch3_2-maximum-likelihood-estimation`); IRLS weight matrices (:ref:`ch3_5-generalized-linear-models`) * **Chapter 4** (Resampling): Sherman-Morrison-Woodbury for LOOCV shortcuts (:ref:`ch4_8-cross-validation`); influence diagnostics via the hat matrix (:ref:`ch4_5-jackknife-methods`) * **Chapter 5** (Bayesian): Transition matrices for Markov chains (:ref:`ch5_4-markov-chains`); mass matrix in Hamiltonian Monte Carlo (:ref:`ch5_5-mcmc-algorithms`) .. contents:: Contents :local: :depth: 2 Vectors and Inner Products --------------------------- A **vector** :math:`\mathbf{x} \in \mathbb{R}^n` is an ordered list of :math:`n` real numbers. Throughout this course, vectors are column vectors by default: .. math:: \mathbf{x} = \begin{pmatrix} x_1 \\ x_2 \\ \vdots \\ x_n \end{pmatrix} The **transpose** :math:`\mathbf{x}^\top = (x_1, x_2, \ldots, x_n)` gives a row vector. Inner Product and Norm ~~~~~~~~~~~~~~~~~~~~~~~ .. admonition:: Definition :class: definition The **inner product** (dot product) of two vectors :math:`\mathbf{x}, \mathbf{y} \in \mathbb{R}^n` is: .. math:: \langle \mathbf{x}, \mathbf{y} \rangle = \mathbf{x}^\top \mathbf{y} = \sum_{i=1}^n x_i y_i The **Euclidean norm** (length) of a vector is: .. math:: \|\mathbf{x}\| = \sqrt{\mathbf{x}^\top \mathbf{x}} = \sqrt{\sum_{i=1}^n x_i^2} The inner product measures how well two vectors align. When :math:`\mathbf{x}^\top \mathbf{y} = 0`, the vectors are **orthogonal** β€” they point in perpendicular directions. This geometric intuition is central to least squares: the residual vector is orthogonal to the space of fitted values. .. admonition:: Key Properties :class: tip * **Symmetry**: :math:`\mathbf{x}^\top \mathbf{y} = \mathbf{y}^\top \mathbf{x}` * **Linearity**: :math:`\mathbf{x}^\top(a\mathbf{y} + b\mathbf{z}) = a\,\mathbf{x}^\top \mathbf{y} + b\,\mathbf{x}^\top \mathbf{z}` * **Cauchy-Schwarz inequality**: :math:`|\mathbf{x}^\top \mathbf{y}| \leq \|\mathbf{x}\| \cdot \|\mathbf{y}\|`, with equality if and only if :math:`\mathbf{x}` and :math:`\mathbf{y}` are linearly dependent * **Triangle inequality**: :math:`\|\mathbf{x} + \mathbf{y}\| \leq \|\mathbf{x}\| + \|\mathbf{y}\|` The Cauchy-Schwarz inequality appears in the derivation of the CramΓ©r-Rao lower bound (see :ref:`ch3_2-maximum-likelihood-estimation`), where it establishes the minimum variance achievable by any unbiased estimator. .. code-block:: python import numpy as np x = np.array([3, 1, 4]) y = np.array([2, 7, 1]) # Inner product dot = x @ y # 17 dot_alt = np.dot(x, y) # equivalent # Norm norm_x = np.linalg.norm(x) # sqrt(26) β‰ˆ 5.099 # Verify Cauchy-Schwarz assert abs(x @ y) <= np.linalg.norm(x) * np.linalg.norm(y) Orthogonality ~~~~~~~~~~~~~~ Two vectors are **orthogonal** if :math:`\mathbf{x}^\top \mathbf{y} = 0`. A set of vectors :math:`\{\mathbf{q}_1, \ldots, \mathbf{q}_k\}` is **orthonormal** if: .. math:: \mathbf{q}_i^\top \mathbf{q}_j = \begin{cases} 1 & \text{if } i = j \\ 0 & \text{if } i \neq j \end{cases} Equivalently, stacking these vectors as columns of a matrix :math:`\mathbf{Q}`, orthonormality means :math:`\mathbf{Q}^\top \mathbf{Q} = \mathbf{I}`. If :math:`\mathbf{Q}` is square, this also gives :math:`\mathbf{Q}\mathbf{Q}^\top = \mathbf{I}`, so :math:`\mathbf{Q}^{-1} = \mathbf{Q}^\top` β€” the inverse is just the transpose. Such a matrix is called **orthogonal**. Orthogonal matrices preserve lengths and angles: :math:`\|\mathbf{Q}\mathbf{x}\| = \|\mathbf{x}\|`. This makes them numerically ideal β€” they never amplify errors, which is why QR decomposition is preferred over forming :math:`\mathbf{X}^\top\mathbf{X}` directly. Matrix Operations and Properties ---------------------------------- A **matrix** :math:`\mathbf{A} \in \mathbb{R}^{m \times n}` has :math:`m` rows and :math:`n` columns. We write :math:`A_{ij}` or :math:`a_{ij}` for the entry in row :math:`i`, column :math:`j`. Multiplication, Transpose, and Inverse ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ **Matrix multiplication.** If :math:`\mathbf{A}` is :math:`m \times n` and :math:`\mathbf{B}` is :math:`n \times p`, the product :math:`\mathbf{C} = \mathbf{AB}` is :math:`m \times p` with entries: .. math:: C_{ij} = \sum_{k=1}^n A_{ik} B_{kj} Key properties: * **Not commutative**: :math:`\mathbf{AB} \neq \mathbf{BA}` in general * **Associative**: :math:`(\mathbf{AB})\mathbf{C} = \mathbf{A}(\mathbf{BC})` * **Distributive**: :math:`\mathbf{A}(\mathbf{B} + \mathbf{C}) = \mathbf{AB} + \mathbf{AC}` * **Transpose of product**: :math:`(\mathbf{AB})^\top = \mathbf{B}^\top \mathbf{A}^\top` (order reverses) **Transpose.** :math:`(\mathbf{A}^\top)_{ij} = A_{ji}` β€” rows become columns. A matrix is **symmetric** if :math:`\mathbf{A} = \mathbf{A}^\top`. Covariance matrices and Fisher information matrices are always symmetric. **Inverse.** A square matrix :math:`\mathbf{A}` is **invertible** (nonsingular) if there exists :math:`\mathbf{A}^{-1}` such that :math:`\mathbf{A}\mathbf{A}^{-1} = \mathbf{A}^{-1}\mathbf{A} = \mathbf{I}`. Key properties: * :math:`(\mathbf{AB})^{-1} = \mathbf{B}^{-1}\mathbf{A}^{-1}` (order reverses) * :math:`(\mathbf{A}^\top)^{-1} = (\mathbf{A}^{-1})^\top` * :math:`(\mathbf{A}^{-1})^{-1} = \mathbf{A}` .. admonition:: Common Pitfall ⚠️ :class: warning In practice, you almost never compute :math:`\mathbf{A}^{-1}` explicitly. To solve :math:`\mathbf{A}\mathbf{x} = \mathbf{b}`, use ``np.linalg.solve(A, b)`` rather than ``np.linalg.inv(A) @ b``. The solve approach is faster and more numerically stable because it uses LU factorization internally without forming the full inverse. Trace ~~~~~~ .. admonition:: Definition :class: definition The **trace** of a square matrix :math:`\mathbf{A} \in \mathbb{R}^{n \times n}` is the sum of its diagonal entries: .. math:: \text{tr}(\mathbf{A}) = \sum_{i=1}^n A_{ii} The trace has remarkably useful algebraic properties: * **Linearity**: :math:`\text{tr}(\mathbf{A} + \mathbf{B}) = \text{tr}(\mathbf{A}) + \text{tr}(\mathbf{B})` and :math:`\text{tr}(c\mathbf{A}) = c \cdot \text{tr}(\mathbf{A})` * **Cyclic property**: :math:`\text{tr}(\mathbf{ABC}) = \text{tr}(\mathbf{CAB}) = \text{tr}(\mathbf{BCA})` * **Transpose invariance**: :math:`\text{tr}(\mathbf{A}^\top) = \text{tr}(\mathbf{A})` * **Inner product connection**: :math:`\mathbf{x}^\top \mathbf{A} \mathbf{x} = \text{tr}(\mathbf{A}\mathbf{x}\mathbf{x}^\top)` The cyclic property is especially powerful. Note that while :math:`\text{tr}(\mathbf{ABC}) = \text{tr}(\mathbf{CAB})`, the trace is *not* invariant under arbitrary permutations: :math:`\text{tr}(\mathbf{ABC}) \neq \text{tr}(\mathbf{BAC})` in general. In linear models, the trace gives the **effective degrees of freedom**: :math:`\text{tr}(\mathbf{H}) = p` for the hat matrix :math:`\mathbf{H}`, generalizing to :math:`\text{tr}(\mathbf{S}_\lambda)` for smoothers and regularized estimators (see :ref:`ch4_8-cross-validation`). Determinant ~~~~~~~~~~~~ The **determinant** :math:`\det(\mathbf{A})` is a scalar that encodes the volume-scaling factor of the linear transformation represented by :math:`\mathbf{A}`. Key properties: * :math:`\det(\mathbf{A}) \neq 0` if and only if :math:`\mathbf{A}` is invertible * :math:`\det(\mathbf{AB}) = \det(\mathbf{A})\det(\mathbf{B})` * :math:`\det(\mathbf{A}^\top) = \det(\mathbf{A})` * :math:`\det(c\mathbf{A}) = c^n \det(\mathbf{A})` for :math:`\mathbf{A} \in \mathbb{R}^{n \times n}` * :math:`\det(\mathbf{A}^{-1}) = 1/\det(\mathbf{A})` For diagonal or triangular matrices, the determinant is simply the product of diagonal entries: :math:`\det(\mathbf{A}) = \prod_i A_{ii}`. The determinant appears prominently in probability through the multivariate normal density: .. math:: f(\mathbf{x}) = \frac{1}{(2\pi)^{p/2} |\boldsymbol{\Sigma}|^{1/2}} \exp\!\left(-\frac{1}{2}(\mathbf{x} - \boldsymbol{\mu})^\top \boldsymbol{\Sigma}^{-1} (\mathbf{x} - \boldsymbol{\mu})\right) where :math:`|\boldsymbol{\Sigma}| = \det(\boldsymbol{\Sigma})`. It also appears in the Jacobian formula for change of variables (see :ref:`Jacobian and Change of Variables `) and in log-likelihoods for multivariate models. Rank ~~~~~ The **rank** of a matrix :math:`\mathbf{A} \in \mathbb{R}^{m \times n}` is the dimension of its column space β€” equivalently, the maximum number of linearly independent columns (or rows). A matrix has **full column rank** if :math:`\text{rank}(\mathbf{A}) = n` (all columns are linearly independent), and **full row rank** if :math:`\text{rank}(\mathbf{A}) = m`. For the design matrix :math:`\mathbf{X} \in \mathbb{R}^{n \times p}` in linear regression, the full rank assumption :math:`\text{rank}(\mathbf{X}) = p` is equivalent to requiring that :math:`\mathbf{X}^\top\mathbf{X}` is invertible. When this fails β€” due to perfect collinearity among predictors β€” the OLS estimator :math:`(\mathbf{X}^\top\mathbf{X})^{-1}\mathbf{X}^\top\mathbf{y}` does not exist, and regularization (ridge, LASSO) or variable selection is needed. .. code-block:: python import numpy as np A = np.array([[1, 2, 3], [4, 5, 6], [7, 8, 9]]) print(f"Rank: {np.linalg.matrix_rank(A)}") # 2 (row 3 = 2*row2 - row1) print(f"Determinant: {np.linalg.det(A):.6f}") # β‰ˆ 0 (singular) print(f"Trace: {np.trace(A)}") # 15 Special Matrix Structures -------------------------- Certain matrix structures arise repeatedly in statistics. Recognizing them unlocks computational shortcuts and theoretical insights. Several of the properties below are stated in terms of **eigenvalues** β€” the scalars :math:`\lambda` satisfying :math:`\mathbf{A}\mathbf{v} = \lambda \mathbf{v}` for some nonzero **eigenvector** :math:`\mathbf{v}`, so that :math:`\mathbf{A}` acts on :math:`\mathbf{v}` by pure scaling. Eigenvalues are developed fully in the Spectral Theorem (see Matrix Decompositions below); for now, the defining equation is all we need. Symmetric Matrices ~~~~~~~~~~~~~~~~~~~ A matrix :math:`\mathbf{A}` is **symmetric** if :math:`\mathbf{A} = \mathbf{A}^\top`. Every covariance matrix, every Fisher information matrix, and every Hessian of a smooth function is symmetric. Symmetric matrices have three important properties: 1. All eigenvalues are **real** (not complex) 2. Eigenvectors corresponding to distinct eigenvalues are **orthogonal** 3. Every symmetric matrix admits a **spectral decomposition** :math:`\mathbf{A} = \mathbf{Q}\boldsymbol{\Lambda}\mathbf{Q}^\top` with orthogonal :math:`\mathbf{Q}` These properties are the foundation of principal component analysis (PCA) and the spectral analysis of Markov chains. Diagonal and Identity Matrices ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ A **diagonal matrix** :math:`\mathbf{D} = \text{diag}(d_1, \ldots, d_n)` has nonzero entries only on the main diagonal. Diagonal matrices are trivial to invert (:math:`\mathbf{D}^{-1} = \text{diag}(1/d_1, \ldots, 1/d_n)`) and their determinant is :math:`\prod_i d_i`. The **identity matrix** :math:`\mathbf{I}_n` is the diagonal matrix with all ones β€” the multiplicative identity: :math:`\mathbf{AI} = \mathbf{IA} = \mathbf{A}`. In GLM fitting, the weight matrix :math:`\mathbf{W} = \text{diag}(w_1, \ldots, w_n)` is diagonal, making the weighted least squares step :math:`(\mathbf{X}^\top\mathbf{W}\mathbf{X})^{-1}\mathbf{X}^\top\mathbf{W}\mathbf{z}` efficient to compute (see :ref:`ch3_5-generalized-linear-models`). Idempotent Matrices ~~~~~~~~~~~~~~~~~~~~ .. admonition:: Definition :class: definition A matrix :math:`\mathbf{P}` is **idempotent** if :math:`\mathbf{P}^2 = \mathbf{P}`. Idempotency means "applying the operation twice is the same as applying it once" β€” the defining property of a projection. If you project a vector onto a subspace, projecting the result again changes nothing. The hat matrix :math:`\mathbf{H} = \mathbf{X}(\mathbf{X}^\top\mathbf{X})^{-1}\mathbf{X}^\top` is idempotent, and so is the residual-maker :math:`\mathbf{M} = \mathbf{I} - \mathbf{H}`. Key properties of idempotent matrices: * Eigenvalues are either 0 or 1 * :math:`\text{rank}(\mathbf{P}) = \text{tr}(\mathbf{P})` (the trace counts the number of eigenvalue-1 directions) * If :math:`\mathbf{P}` is also symmetric, it is an **orthogonal projection matrix** .. admonition:: Derivation: Eigenvalues of Idempotent Matrices :class: proof If :math:`\mathbf{P}\mathbf{v} = \lambda \mathbf{v}` for eigenvector :math:`\mathbf{v} \neq \mathbf{0}`, then: .. math:: \mathbf{P}^2 \mathbf{v} = \mathbf{P}(\mathbf{P}\mathbf{v}) = \mathbf{P}(\lambda \mathbf{v}) = \lambda(\mathbf{P}\mathbf{v}) = \lambda^2 \mathbf{v} But :math:`\mathbf{P}^2 = \mathbf{P}`, so :math:`\mathbf{P}^2 \mathbf{v} = \mathbf{P}\mathbf{v} = \lambda \mathbf{v}`. Therefore :math:`\lambda^2 = \lambda`, which gives :math:`\lambda = 0` or :math:`\lambda = 1`. Positive Definite and Positive Semi-Definite Matrices ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ .. admonition:: Definition :class: definition A symmetric matrix :math:`\mathbf{A} \in \mathbb{R}^{n \times n}` is: * **Positive definite** (PD) if :math:`\mathbf{x}^\top \mathbf{A} \mathbf{x} > 0` for all :math:`\mathbf{x} \neq \mathbf{0}` * **Positive semi-definite** (PSD) if :math:`\mathbf{x}^\top \mathbf{A} \mathbf{x} \geq 0` for all :math:`\mathbf{x}` Equivalently: * PD :math:`\iff` all eigenvalues are strictly positive * PSD :math:`\iff` all eigenvalues are non-negative Positive definiteness is the matrix analogue of a positive number β€” it guarantees that a quadratic form :math:`\mathbf{x}^\top\mathbf{A}\mathbf{x}` has a unique minimum at :math:`\mathbf{x} = \mathbf{0}`, which is essential for: * **Covariance matrices**: Every covariance matrix is PSD; it is PD if no variable is a deterministic linear combination of others * **Fisher information matrices**: PD under regularity conditions, ensuring the MLE is unique and the CramΓ©r-Rao bound is finite * **Hessians at optima**: The Hessian of a log-likelihood being negative definite at :math:`\hat{\boldsymbol{\theta}}` confirms a local maximum * **Cholesky decomposition**: A unique Cholesky factor with strictly positive diagonal exists if and only if the matrix is PD .. code-block:: python import numpy as np # A positive definite matrix A = np.array([[4, 2], [2, 3]]) eigenvalues = np.linalg.eigvalsh(A) print(f"Eigenvalues: {eigenvalues}") # [1.438, 5.562] β€” both positive β†’ PD # Verify: x'Ax > 0 for random x rng = np.random.default_rng(42) for _ in range(1000): x = rng.standard_normal(2) assert x @ A @ x > 0 Stochastic Matrices ~~~~~~~~~~~~~~~~~~~~ .. admonition:: Definition :class: definition A square matrix :math:`\mathbf{P}` is **(row-)stochastic** if: * All entries are non-negative: :math:`P_{ij} \geq 0` * Each row sums to 1: :math:`\sum_j P_{ij} = 1` Stochastic matrices are **transition matrices** for Markov chains: :math:`P_{ij}` is the probability of moving from state :math:`i` to state :math:`j`. In Chapter 5, the :math:`k`-step transition probabilities are given by :math:`\mathbf{P}^k`, and the **stationary distribution** :math:`\boldsymbol{\pi}` satisfies :math:`\boldsymbol{\pi}^\top \mathbf{P} = \boldsymbol{\pi}^\top` β€” it is a left eigenvector of :math:`\mathbf{P}` with eigenvalue 1 (see :ref:`ch5_4-markov-chains`). The **Perron-Frobenius theorem** guarantees that for an irreducible, aperiodic stochastic matrix, eigenvalue 1 has multiplicity one and all other eigenvalues satisfy :math:`|\lambda| < 1`. This ensures the Markov chain converges to a unique stationary distribution regardless of starting state β€” the theoretical foundation for MCMC. Block Matrices --------------- Many matrices in statistics have natural block structure. The design matrix might partition into :math:`\mathbf{X} = [\mathbf{X}_1 \mid \mathbf{X}_2]` separating groups of predictors. A covariance matrix for two groups of variables decomposes into within-group and between-group blocks. Working with blocks rather than individual entries simplifies both algebra and computation. Block Partitioning ~~~~~~~~~~~~~~~~~~~ A matrix can be partitioned into **blocks** (sub-matrices): .. math:: \mathbf{A} = \begin{pmatrix} \mathbf{A}_{11} & \mathbf{A}_{12} \\ \mathbf{A}_{21} & \mathbf{A}_{22} \end{pmatrix} where :math:`\mathbf{A}_{11}` is :math:`p \times p`, :math:`\mathbf{A}_{12}` is :math:`p \times q`, :math:`\mathbf{A}_{21}` is :math:`q \times p`, and :math:`\mathbf{A}_{22}` is :math:`q \times q`. Block Multiplication ~~~~~~~~~~~~~~~~~~~~~ Block matrices multiply according to the same row-times-column rule, but with sub-matrix products replacing scalar products: .. math:: \begin{pmatrix} \mathbf{A}_{11} & \mathbf{A}_{12} \\ \mathbf{A}_{21} & \mathbf{A}_{22} \end{pmatrix} \begin{pmatrix} \mathbf{B}_{11} & \mathbf{B}_{12} \\ \mathbf{B}_{21} & \mathbf{B}_{22} \end{pmatrix} = \begin{pmatrix} \mathbf{A}_{11}\mathbf{B}_{11} + \mathbf{A}_{12}\mathbf{B}_{21} & \mathbf{A}_{11}\mathbf{B}_{12} + \mathbf{A}_{12}\mathbf{B}_{22} \\ \mathbf{A}_{21}\mathbf{B}_{11} + \mathbf{A}_{22}\mathbf{B}_{21} & \mathbf{A}_{21}\mathbf{B}_{12} + \mathbf{A}_{22}\mathbf{B}_{22} \end{pmatrix} This is valid whenever the inner dimensions of each sub-matrix product are compatible. Block Transpose and Block Diagonal ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ The transpose of a block matrix transposes the arrangement *and* each block: .. math:: \begin{pmatrix} \mathbf{A}_{11} & \mathbf{A}_{12} \\ \mathbf{A}_{21} & \mathbf{A}_{22} \end{pmatrix}^\top = \begin{pmatrix} \mathbf{A}_{11}^\top & \mathbf{A}_{21}^\top \\ \mathbf{A}_{12}^\top & \mathbf{A}_{22}^\top \end{pmatrix} A **block diagonal** matrix has non-zero blocks only on the diagonal: .. math:: \text{diag}(\mathbf{A}_1, \ldots, \mathbf{A}_k) = \begin{pmatrix} \mathbf{A}_1 & & \\ & \ddots & \\ & & \mathbf{A}_k \end{pmatrix} Block diagonal matrices are especially convenient: their inverse is :math:`\text{diag}(\mathbf{A}_1^{-1}, \ldots, \mathbf{A}_k^{-1})`, their determinant is :math:`\prod_i \det(\mathbf{A}_i)`, and their eigenvalues are the union of each block's eigenvalues. They arise in hierarchical models where groups are conditionally independent. The Schur Complement ~~~~~~~~~~~~~~~~~~~~~ .. admonition:: Definition :class: definition Given a block matrix with :math:`\mathbf{A}_{11}` invertible: .. math:: \mathbf{A} = \begin{pmatrix} \mathbf{A}_{11} & \mathbf{A}_{12} \\ \mathbf{A}_{21} & \mathbf{A}_{22} \end{pmatrix} the **Schur complement** of :math:`\mathbf{A}_{11}` in :math:`\mathbf{A}` is: .. math:: \mathbf{S} = \mathbf{A}_{22} - \mathbf{A}_{21}\mathbf{A}_{11}^{-1}\mathbf{A}_{12} The Schur complement is the key to block matrix inversion and appears throughout statistics: **Block inverse.** If both :math:`\mathbf{A}_{11}` and :math:`\mathbf{S}` are invertible: .. math:: \begin{pmatrix} \mathbf{A}_{11} & \mathbf{A}_{12} \\ \mathbf{A}_{21} & \mathbf{A}_{22} \end{pmatrix}^{-1} = \begin{pmatrix} \mathbf{A}_{11}^{-1} + \mathbf{A}_{11}^{-1}\mathbf{A}_{12}\mathbf{S}^{-1}\mathbf{A}_{21}\mathbf{A}_{11}^{-1} & -\mathbf{A}_{11}^{-1}\mathbf{A}_{12}\mathbf{S}^{-1} \\ -\mathbf{S}^{-1}\mathbf{A}_{21}\mathbf{A}_{11}^{-1} & \mathbf{S}^{-1} \end{pmatrix} **Block determinant:** .. math:: \det(\mathbf{A}) = \det(\mathbf{A}_{11}) \cdot \det(\mathbf{S}) .. admonition:: Statistical Application: Conditional Distributions :class: tip For a multivariate normal :math:`(\mathbf{X}_1, \mathbf{X}_2)^\top \sim \mathcal{N}(\boldsymbol{\mu}, \boldsymbol{\Sigma})` with: .. math:: \boldsymbol{\Sigma} = \begin{pmatrix} \boldsymbol{\Sigma}_{11} & \boldsymbol{\Sigma}_{12} \\ \boldsymbol{\Sigma}_{21} & \boldsymbol{\Sigma}_{22} \end{pmatrix} the conditional distribution :math:`\mathbf{X}_1 \mid \mathbf{X}_2 = \mathbf{x}_2` is normal with: .. math:: \mathbb{E}[\mathbf{X}_1 \mid \mathbf{X}_2] &= \boldsymbol{\mu}_1 + \boldsymbol{\Sigma}_{12}\boldsymbol{\Sigma}_{22}^{-1}(\mathbf{x}_2 - \boldsymbol{\mu}_2) \\ \text{Var}(\mathbf{X}_1 \mid \mathbf{X}_2) &= \boldsymbol{\Sigma}_{11} - \boldsymbol{\Sigma}_{12}\boldsymbol{\Sigma}_{22}^{-1}\boldsymbol{\Sigma}_{21} The conditional covariance is exactly the Schur complement of :math:`\boldsymbol{\Sigma}_{22}` in :math:`\boldsymbol{\Sigma}`. This formula drives Gibbs sampling for multivariate normals in Chapter 5. Sherman-Morrison-Woodbury Formula ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ .. admonition:: Theorem: Sherman-Morrison-Woodbury :class: theorem If :math:`\mathbf{A} \in \mathbb{R}^{n \times n}` and :math:`\mathbf{C} \in \mathbb{R}^{k \times k}` are invertible, :math:`\mathbf{U} \in \mathbb{R}^{n \times k}` and :math:`\mathbf{V} \in \mathbb{R}^{k \times n}`, and :math:`\mathbf{C}^{-1} + \mathbf{V}\mathbf{A}^{-1}\mathbf{U}` is also invertible: .. math:: (\mathbf{A} + \mathbf{U}\mathbf{C}\mathbf{V})^{-1} = \mathbf{A}^{-1} - \mathbf{A}^{-1}\mathbf{U}(\mathbf{C}^{-1} + \mathbf{V}\mathbf{A}^{-1}\mathbf{U})^{-1}\mathbf{V}\mathbf{A}^{-1} The special case with :math:`k = 1` (rank-1 update) is the **Sherman-Morrison formula**: for vectors :math:`\mathbf{u}, \mathbf{v}` with :math:`1 + \mathbf{v}^\top\mathbf{A}^{-1}\mathbf{u} \neq 0`: .. math:: (\mathbf{A} + \mathbf{u}\mathbf{v}^\top)^{-1} = \mathbf{A}^{-1} - \frac{\mathbf{A}^{-1}\mathbf{u}\mathbf{v}^\top\mathbf{A}^{-1}}{1 + \mathbf{v}^\top\mathbf{A}^{-1}\mathbf{u}} This converts inverting an :math:`n \times n` matrix into inverting a :math:`k \times k` matrix (plus some matrix-vector products). When :math:`k \ll n`, this is a dramatic speedup. The formula is central to the **LOOCV shortcut** in :ref:`ch4_8-cross-validation`: deleting observation :math:`i` from the regression amounts to a rank-1 update of :math:`\mathbf{X}^\top\mathbf{X}`, allowing all :math:`n` leave-one-out fits to be computed from a single full-data fit. It also appears in Bayesian posterior updating when a new observation arrives. .. admonition:: Derivation: Sherman-Morrison-Woodbury from Block Inversion :class: proof The formula follows from applying the block inverse to: .. math:: \begin{pmatrix} \mathbf{A} & \mathbf{U} \\ \mathbf{V} & -\mathbf{C}^{-1} \end{pmatrix} The Schur complement of :math:`-\mathbf{C}^{-1}` is :math:`\mathbf{A} + \mathbf{U}\mathbf{C}\mathbf{V}`, and the block inverse formula gives the result directly. This derivation shows that SMW is not a separate identity β€” it is a consequence of block matrix algebra. .. code-block:: python import numpy as np rng = np.random.default_rng(42) n, k = 100, 3 A = rng.standard_normal((n, n)) A = A @ A.T + np.eye(n) # make PD U = rng.standard_normal((n, k)) C = np.eye(k) V = rng.standard_normal((k, n)) # Direct inversion direct = np.linalg.inv(A + U @ C @ V) # Sherman-Morrison-Woodbury A_inv = np.linalg.inv(A) inner = np.linalg.inv(np.linalg.inv(C) + V @ A_inv @ U) smw = A_inv - A_inv @ U @ inner @ V @ A_inv print(f"Max difference: {np.max(np.abs(direct - smw)):.2e}") # β‰ˆ 1e-11 Column Space, Projections, and Least Squares ---------------------------------------------- This section develops the geometric backbone of linear regression. The central idea: fitting a linear model is equivalent to projecting the response vector onto the column space of the design matrix. Column Space and Null Space ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ .. admonition:: Definition :class: definition The **column space** (range) of :math:`\mathbf{X} \in \mathbb{R}^{n \times p}` is the set of all linear combinations of its columns: .. math:: \mathcal{C}(\mathbf{X}) = \{\mathbf{X}\boldsymbol{\beta} : \boldsymbol{\beta} \in \mathbb{R}^p\} The **null space** (kernel) is the set of vectors mapped to zero: .. math:: \mathcal{N}(\mathbf{X}) = \{\boldsymbol{\beta} \in \mathbb{R}^p : \mathbf{X}\boldsymbol{\beta} = \mathbf{0}\} The column space of :math:`\mathbf{X}` is a :math:`p`-dimensional subspace of :math:`\mathbb{R}^n` (assuming full column rank). It contains every possible vector of fitted values :math:`\hat{\mathbf{y}} = \mathbf{X}\boldsymbol{\beta}`. Since typically :math:`p \ll n`, this subspace is a "thin slice" of the full :math:`n`-dimensional space β€” and the response :math:`\mathbf{y}` almost certainly does not lie in it. Orthogonal Projection ~~~~~~~~~~~~~~~~~~~~~~~ The best approximation to :math:`\mathbf{y}` within :math:`\mathcal{C}(\mathbf{X})` is the **orthogonal projection** β€” the point in the subspace closest to :math:`\mathbf{y}` in Euclidean distance. .. admonition:: Theorem: Orthogonal Projection :class: theorem The orthogonal projection of :math:`\mathbf{y}` onto :math:`\mathcal{C}(\mathbf{X})` is :math:`\hat{\mathbf{y}} = \mathbf{H}\mathbf{y}`, where: .. math:: \mathbf{H} = \mathbf{X}(\mathbf{X}^\top\mathbf{X})^{-1}\mathbf{X}^\top The residual :math:`\mathbf{e} = \mathbf{y} - \hat{\mathbf{y}} = (\mathbf{I} - \mathbf{H})\mathbf{y}` is orthogonal to the column space: :math:`\mathbf{X}^\top \mathbf{e} = \mathbf{0}`. .. admonition:: Derivation: Projection Minimizes Squared Distance :class: proof We seek :math:`\hat{\boldsymbol{\beta}} = \arg\min_{\boldsymbol{\beta}} \|\mathbf{y} - \mathbf{X}\boldsymbol{\beta}\|^2`. Expanding: .. math:: \|\mathbf{y} - \mathbf{X}\boldsymbol{\beta}\|^2 = \mathbf{y}^\top\mathbf{y} - 2\boldsymbol{\beta}^\top\mathbf{X}^\top\mathbf{y} + \boldsymbol{\beta}^\top\mathbf{X}^\top\mathbf{X}\boldsymbol{\beta} Taking the gradient with respect to :math:`\boldsymbol{\beta}` and setting it to zero: .. math:: -2\mathbf{X}^\top\mathbf{y} + 2\mathbf{X}^\top\mathbf{X}\boldsymbol{\beta} = \mathbf{0} gives the **normal equations** :math:`\mathbf{X}^\top\mathbf{X}\hat{\boldsymbol{\beta}} = \mathbf{X}^\top\mathbf{y}`, so :math:`\hat{\boldsymbol{\beta}} = (\mathbf{X}^\top\mathbf{X})^{-1}\mathbf{X}^\top\mathbf{y}` and :math:`\hat{\mathbf{y}} = \mathbf{X}\hat{\boldsymbol{\beta}} = \mathbf{H}\mathbf{y}`. The normal equations :math:`\mathbf{X}^\top(\mathbf{y} - \mathbf{X}\hat{\boldsymbol{\beta}}) = \mathbf{0}` state precisely that the residual is orthogonal to the column space β€” the geometric characterization of the closest point in a subspace. The Hat Matrix ~~~~~~~~~~~~~~~ The projection matrix :math:`\mathbf{H} = \mathbf{X}(\mathbf{X}^\top\mathbf{X})^{-1}\mathbf{X}^\top` is called the **hat matrix** because it "puts the hat on :math:`\mathbf{y}`": :math:`\hat{\mathbf{y}} = \mathbf{H}\mathbf{y}`. .. admonition:: Theorem: Hat Matrix Properties :class: theorem The hat matrix satisfies: 1. **Symmetric**: :math:`\mathbf{H}^\top = \mathbf{H}` 2. **Idempotent**: :math:`\mathbf{H}^2 = \mathbf{H}` 3. **Rank and trace**: :math:`\text{tr}(\mathbf{H}) = \text{rank}(\mathbf{H}) = p` 4. **Diagonal bounds**: :math:`0 \leq h_{ii} \leq 1` for all :math:`i`, where :math:`h_{ii} = \mathbf{x}_i^\top(\mathbf{X}^\top\mathbf{X})^{-1}\mathbf{x}_i` .. admonition:: Derivation: Hat Matrix is Symmetric and Idempotent :class: proof **Symmetry**: :math:`\mathbf{H}^\top = [\mathbf{X}(\mathbf{X}^\top\mathbf{X})^{-1}\mathbf{X}^\top]^\top = \mathbf{X}[(\mathbf{X}^\top\mathbf{X})^{-1}]^\top\mathbf{X}^\top = \mathbf{X}(\mathbf{X}^\top\mathbf{X})^{-1}\mathbf{X}^\top = \mathbf{H}`, since :math:`(\mathbf{X}^\top\mathbf{X})^{-1}` is symmetric. **Idempotent**: :math:`\mathbf{H}^2 = \mathbf{X}(\mathbf{X}^\top\mathbf{X})^{-1}\mathbf{X}^\top \mathbf{X}(\mathbf{X}^\top\mathbf{X})^{-1}\mathbf{X}^\top = \mathbf{X}(\mathbf{X}^\top\mathbf{X})^{-1}\mathbf{X}^\top = \mathbf{H}`, since the middle :math:`\mathbf{X}^\top\mathbf{X}` cancels with :math:`(\mathbf{X}^\top\mathbf{X})^{-1}`. The **residual-maker matrix** :math:`\mathbf{M} = \mathbf{I} - \mathbf{H}` is also symmetric and idempotent, with :math:`\text{tr}(\mathbf{M}) = n - p`. It projects onto the orthogonal complement of :math:`\mathcal{C}(\mathbf{X})` β€” the space of residuals. Leverage ~~~~~~~~~ The diagonal element :math:`h_{ii}` measures the **leverage** of observation :math:`i` β€” how much influence its position in predictor space has on its own fitted value. High-leverage points are far from the center of the predictor cloud and can disproportionately influence the regression fit. Since :math:`\sum_{i=1}^n h_{ii} = \text{tr}(\mathbf{H}) = p`, the average leverage is :math:`p/n`. Observations with :math:`h_{ii} > 2p/n` (twice the average) warrant closer inspection. Leverage connects to several diagnostics developed in :ref:`ch4_5-jackknife-methods`: * **LOOCV shortcut**: The leave-one-out residual is :math:`e_{(i)} = e_i / (1 - h_{ii})` * **Cook's distance**: :math:`D_i = \frac{e_i^2}{p \cdot s^2} \cdot \frac{h_{ii}}{(1 - h_{ii})^2}` * **DFFITS**: :math:`\text{DFFITS}_i = e_i \sqrt{h_{ii}} / (s_{(i)}(1 - h_{ii}))` .. code-block:: python import numpy as np rng = np.random.default_rng(42) n, p = 50, 3 X = np.column_stack([np.ones(n), rng.standard_normal((n, p - 1))]) y = X @ np.array([1, 2, -1]) + rng.standard_normal(n) # Hat matrix H = X @ np.linalg.solve(X.T @ X, X.T) # Verify properties print(f"Symmetric: {np.allclose(H, H.T)}") # True print(f"Idempotent: {np.allclose(H @ H, H)}") # True print(f"Trace: {np.trace(H):.1f}") # 3.0 = p print(f"Max leverage: {np.max(np.diag(H)):.4f}") print(f"Mean leverage: {np.mean(np.diag(H)):.4f}") # p/n = 0.06 # Fitted values via projection y_hat = H @ y residuals = y - y_hat print(f"Orthogonality: {np.max(np.abs(X.T @ residuals)):.2e}") # β‰ˆ 0 .. figure:: https://pqyjaywwccbnqpwgeiuv.supabase.co/storage/v1/object/public/STAT%20418%20Images/assets/Appendices/appendix_c_fig03_projection_geometry.png :alt: Three-panel diagram of regression as projection: the response vector projected onto the column space to give the fitted values with the residual perpendicular to that subspace, the projection and hat-matrix equations, and a numerical check that residuals are orthogonal to fitted values. :align: center :width: 100% **Projection geometry in linear regression.** (a) The response vector :math:`\mathbf{y}` is projected onto the column space :math:`\mathcal{C}(\mathbf{X})` to produce fitted values :math:`\hat{\mathbf{y}}`; the residual :math:`\mathbf{e}` is perpendicular to the subspace. (b) The projection equations and hat matrix properties. (c) Numerical verification that residuals are orthogonal to fitted values. Matrix Decompositions ---------------------- Matrix decompositions reveal hidden structure. Each decomposition answers a different question about a matrix, and each has distinct computational applications. Eigendecomposition (Spectral Decomposition) ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ .. admonition:: Theorem: Spectral Theorem :class: theorem Every real symmetric matrix :math:`\mathbf{A} \in \mathbb{R}^{n \times n}` can be decomposed as: .. math:: \mathbf{A} = \mathbf{Q}\boldsymbol{\Lambda}\mathbf{Q}^\top = \sum_{i=1}^n \lambda_i \mathbf{q}_i \mathbf{q}_i^\top where :math:`\mathbf{Q} = [\mathbf{q}_1 \mid \cdots \mid \mathbf{q}_n]` is orthogonal (columns are the eigenvectors) and :math:`\boldsymbol{\Lambda} = \text{diag}(\lambda_1, \ldots, \lambda_n)` contains the eigenvalues. The eigendecomposition reveals: * **Principal directions**: The eigenvectors :math:`\mathbf{q}_i` are the directions along which :math:`\mathbf{A}` acts by pure scaling (no rotation) * **Scaling factors**: The eigenvalues :math:`\lambda_i` give the scaling magnitude in each direction * **Matrix functions**: :math:`f(\mathbf{A}) = \mathbf{Q} \cdot \text{diag}(f(\lambda_1), \ldots, f(\lambda_n)) \cdot \mathbf{Q}^\top`, so :math:`\mathbf{A}^{-1} = \mathbf{Q}\boldsymbol{\Lambda}^{-1}\mathbf{Q}^\top`, :math:`\mathbf{A}^{1/2} = \mathbf{Q}\boldsymbol{\Lambda}^{1/2}\mathbf{Q}^\top` * **Definiteness**: Read directly from the sign of eigenvalues * **Markov convergence rate**: For a stochastic matrix, the second-largest eigenvalue modulus :math:`|\lambda_2|` governs how fast the chain converges to stationarity (see :ref:`ch5_4-markov-chains`) .. code-block:: python import numpy as np A = np.array([[4, 2], [2, 3]]) eigenvalues, Q = np.linalg.eigh(A) # eigh for symmetric matrices Lambda = np.diag(eigenvalues) # Verify decomposition print(f"Eigenvalues: {eigenvalues}") print(f"Reconstruction error: {np.max(np.abs(A - Q @ Lambda @ Q.T)):.2e}") # Matrix square root A_sqrt = Q @ np.diag(np.sqrt(eigenvalues)) @ Q.T print(f"(A^{1/2})^2 = A? {np.allclose(A_sqrt @ A_sqrt, A)}") # True .. figure:: https://pqyjaywwccbnqpwgeiuv.supabase.co/storage/v1/object/public/STAT%20418%20Images/assets/Appendices/appendix_c_fig01_covariance_ellipse.png :alt: Three covariance ellipses shown with their eigenvector axes; as the correlation grows from panel (a) to (c) the ellipse elongates and its smallest eigenvalue shrinks toward zero, so the matrix approaches singularity. :align: center :width: 100% **Eigendecomposition of covariance matrices.** The eigenvectors :math:`\mathbf{q}_1, \mathbf{q}_2` give the principal directions of variation, and the eigenvalues :math:`\lambda_1, \lambda_2` give the variance in each direction. As correlation increases from panel (a) to panel (c), the ellipse elongates and the smallest eigenvalue shrinks toward zero β€” the matrix approaches singularity. Cholesky Decomposition ~~~~~~~~~~~~~~~~~~~~~~~~ .. admonition:: Theorem: Cholesky Decomposition :class: theorem Every positive definite matrix :math:`\mathbf{A}` has a unique decomposition: .. math:: \mathbf{A} = \mathbf{L}\mathbf{L}^\top where :math:`\mathbf{L}` is lower triangular with positive diagonal entries. This is the **Cholesky factor**. The Cholesky decomposition is the matrix analogue of taking a square root. It is: * **Fast**: :math:`O(n^3/3)` operations β€” half the cost of a general LU factorization * **Stable**: Numerically well-conditioned for PD matrices * **The PD test**: If Cholesky fails, the matrix is not positive definite **Primary statistical application**: Generating correlated random vectors. To sample :math:`\mathbf{X} \sim \mathcal{N}(\boldsymbol{\mu}, \boldsymbol{\Sigma})`: 1. Compute :math:`\mathbf{L}` from :math:`\boldsymbol{\Sigma} = \mathbf{L}\mathbf{L}^\top` 2. Generate :math:`\mathbf{Z} \sim \mathcal{N}(\mathbf{0}, \mathbf{I})` 3. Set :math:`\mathbf{X} = \boldsymbol{\mu} + \mathbf{L}\mathbf{Z}` Then :math:`\text{Var}(\mathbf{X}) = \mathbf{L}\text{Var}(\mathbf{Z})\mathbf{L}^\top = \mathbf{L}\mathbf{I}\mathbf{L}^\top = \boldsymbol{\Sigma}`, using the variance rule for linear transformations (see Covariance Matrices below). This method is used throughout :ref:`ch2.4-transformation-methods` for multivariate sampling. **Solving linear systems**: To solve :math:`\mathbf{A}\mathbf{x} = \mathbf{b}` with PD :math:`\mathbf{A}`, factor :math:`\mathbf{A} = \mathbf{L}\mathbf{L}^\top`, then solve the two triangular systems :math:`\mathbf{L}\mathbf{z} = \mathbf{b}` (forward substitution) and :math:`\mathbf{L}^\top\mathbf{x} = \mathbf{z}` (back substitution). Each triangular solve is :math:`O(n^2)`. .. code-block:: python import numpy as np Sigma = np.array([[1.0, 0.8, 0.3], [0.8, 1.0, 0.5], [0.3, 0.5, 1.0]]) L = np.linalg.cholesky(Sigma) print(f"L =\n{L.round(4)}") print(f"Reconstruction error: {np.max(np.abs(Sigma - L @ L.T)):.2e}") # Generate correlated normals rng = np.random.default_rng(42) Z = rng.standard_normal((3, 10000)) X = L @ Z # each column is a sample print(f"Sample covariance:\n{np.cov(X).round(3)}") # β‰ˆ Sigma .. figure:: https://pqyjaywwccbnqpwgeiuv.supabase.co/storage/v1/object/public/STAT%20418%20Images/assets/Appendices/appendix_c_fig04_cholesky_sampling.png :alt: Three scatter panels: independent standard-normal draws, the Cholesky transform X = L Z that injects the target correlation, and the resulting correlated bivariate-normal samples with correlation rho = 0.8. :align: center :width: 100% **Cholesky decomposition for generating correlated samples.** (a) Independent standard normal draws :math:`\mathbf{Z} \sim \mathcal{N}(\mathbf{0}, \mathbf{I})`. (b) The Cholesky transform :math:`\mathbf{X} = \mathbf{L}\mathbf{Z}` introduces the desired correlation structure. (c) The resulting samples :math:`\mathbf{X} \sim \mathcal{N}(\mathbf{0}, \boldsymbol{\Sigma})` with :math:`\rho = 0.8`. QR Decomposition ~~~~~~~~~~~~~~~~~ .. admonition:: Theorem: QR Decomposition :class: theorem Every matrix :math:`\mathbf{X} \in \mathbb{R}^{n \times p}` with :math:`n \geq p` and full column rank can be decomposed as: .. math:: \mathbf{X} = \mathbf{Q}\mathbf{R} where :math:`\mathbf{Q} \in \mathbb{R}^{n \times p}` has orthonormal columns (:math:`\mathbf{Q}^\top\mathbf{Q} = \mathbf{I}_p`) and :math:`\mathbf{R} \in \mathbb{R}^{p \times p}` is upper triangular with positive diagonal entries. The QR decomposition is the workhorse for **numerically stable regression**. Instead of forming :math:`\mathbf{X}^\top\mathbf{X}` (which squares the condition number), substitute :math:`\mathbf{X} = \mathbf{Q}\mathbf{R}` into the normal equations: .. math:: \mathbf{X}^\top\mathbf{X}\hat{\boldsymbol{\beta}} &= \mathbf{X}^\top\mathbf{y} \\ \mathbf{R}^\top\mathbf{Q}^\top\mathbf{Q}\mathbf{R}\hat{\boldsymbol{\beta}} &= \mathbf{R}^\top\mathbf{Q}^\top\mathbf{y} \\ \mathbf{R}^\top\mathbf{R}\hat{\boldsymbol{\beta}} &= \mathbf{R}^\top\mathbf{Q}^\top\mathbf{y} \\ \mathbf{R}\hat{\boldsymbol{\beta}} &= \mathbf{Q}^\top\mathbf{y} The last line is a triangular system β€” solved in :math:`O(p^2)` by back-substitution. No matrix inversion needed. The hat matrix simplifies to :math:`\mathbf{H} = \mathbf{Q}\mathbf{Q}^\top`, making leverage computation trivial: :math:`h_{ii} = \|\mathbf{q}_i\|^2` where :math:`\mathbf{q}_i` is the :math:`i`-th row of :math:`\mathbf{Q}`. .. code-block:: python import numpy as np rng = np.random.default_rng(42) n, p = 100, 5 X = rng.standard_normal((n, p)) y = X @ np.ones(p) + rng.standard_normal(n) # QR-based regression (numerically stable) Q, R = np.linalg.qr(X) beta_qr = np.linalg.solve(R, Q.T @ y) # Compare with direct normal equations (less stable) beta_direct = np.linalg.solve(X.T @ X, X.T @ y) print(f"Max difference: {np.max(np.abs(beta_qr - beta_direct)):.2e}") # Leverage from Q leverage_qr = np.sum(Q**2, axis=1) H = X @ np.linalg.solve(X.T @ X, X.T) leverage_direct = np.diag(H) print(f"Leverage difference: {np.max(np.abs(leverage_qr - leverage_direct)):.2e}") Singular Value Decomposition (SVD) ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ .. admonition:: Theorem: Singular Value Decomposition :class: theorem Every matrix :math:`\mathbf{X} \in \mathbb{R}^{n \times p}` can be decomposed as: .. math:: \mathbf{X} = \mathbf{U}\boldsymbol{\Sigma}\mathbf{V}^\top where :math:`\mathbf{U} \in \mathbb{R}^{n \times n}` and :math:`\mathbf{V} \in \mathbb{R}^{p \times p}` are orthogonal, and :math:`\boldsymbol{\Sigma} \in \mathbb{R}^{n \times p}` is "diagonal" with non-negative entries :math:`\sigma_1 \geq \sigma_2 \geq \cdots \geq \sigma_{\min(n,p)} \geq 0` called the **singular values**. The **thin SVD** (economical form) uses only the first :math:`r = \min(n, p)` singular values: :math:`\mathbf{X} = \mathbf{U}_r \boldsymbol{\Sigma}_r \mathbf{V}_r^\top`. The SVD is the most general decomposition β€” it applies to *any* matrix, not just square or PD ones. The singular values reveal the "energy" in each direction: * :math:`\sigma_i^2` are the eigenvalues of :math:`\mathbf{X}^\top\mathbf{X}` (the nonzero ones are also eigenvalues of :math:`\mathbf{X}\mathbf{X}^\top`) * Columns of :math:`\mathbf{V}` are the right singular vectors (eigenvectors of :math:`\mathbf{X}^\top\mathbf{X}`) * Columns of :math:`\mathbf{U}` are the left singular vectors (eigenvectors of :math:`\mathbf{X}\mathbf{X}^\top`) **Ridge regression** via SVD: The ridge estimator :math:`\hat{\boldsymbol{\beta}}_\lambda = (\mathbf{X}^\top\mathbf{X} + \lambda\mathbf{I})^{-1}\mathbf{X}^\top\mathbf{y}` becomes: .. math:: \hat{\boldsymbol{\beta}}_\lambda = \mathbf{V} \text{diag}\!\left(\frac{\sigma_i}{\sigma_i^2 + \lambda}\right) \mathbf{U}^\top \mathbf{y} Along each singular direction, the OLS component is shrunk by the factor :math:`\sigma_i^2 / (\sigma_i^2 + \lambda)`. Directions with small singular values (near-collinear predictors) are shrunk the most β€” this is why ridge regression stabilizes ill-conditioned problems. **Effective degrees of freedom** for ridge regression are :math:`\text{df}(\lambda) = \sum_i \sigma_i^2 / (\sigma_i^2 + \lambda)`, a smooth function that interpolates between :math:`p` (at :math:`\lambda = 0`) and :math:`0` (as :math:`\lambda \to \infty`). See :ref:`ch4_8-cross-validation`. **Condition number**: :math:`\kappa(\mathbf{X}) = \sigma_1 / \sigma_p`. A large condition number means the matrix is nearly singular β€” small perturbations in the data cause large changes in the solution. When :math:`\kappa \gg 1`, use QR or SVD rather than forming :math:`\mathbf{X}^\top\mathbf{X}`. .. code-block:: python import numpy as np rng = np.random.default_rng(42) n, p = 100, 5 X = rng.standard_normal((n, p)) U, sigma, Vt = np.linalg.svd(X, full_matrices=False) print(f"Singular values: {sigma.round(3)}") print(f"Condition number: {sigma[0] / sigma[-1]:.2f}") # Ridge regression via SVD y = X @ np.ones(p) + rng.standard_normal(n) lam = 1.0 d = sigma / (sigma**2 + lam) # multiplies U.T @ y; shrinkage factor is sigma**2/(sigma**2 + lam) beta_ridge = Vt.T @ (d * (U.T @ y)) # Effective degrees of freedom df_ridge = np.sum(sigma**2 / (sigma**2 + lam)) print(f"Effective df: {df_ridge:.2f}") # < p = 5 .. figure:: https://pqyjaywwccbnqpwgeiuv.supabase.co/storage/v1/object/public/STAT%20418%20Images/assets/Appendices/appendix_c_fig02_svd_ridge_shrinkage.png :alt: Three panels on SVD and ridge regression: the design matrix's singular values with small near-collinear values highlighted in red, the per-component ridge shrinkage factors that damp weak directions most, and effective degrees of freedom decreasing smoothly from p to 0 as the penalty lambda grows. :align: center :width: 100% **SVD and ridge regression shrinkage.** (a) Singular values of the design matrix β€” small values (red) indicate near-collinear directions. (b) Ridge shrinkage factors :math:`\sigma_i^2/(\sigma_i^2 + \lambda)` by SVD component: weak directions are shrunk most aggressively. (c) Effective degrees of freedom decrease smoothly from :math:`p` to 0 as regularization :math:`\lambda` increases. The SVD view explains *how much* ridge shrinks each direction. There is a complementary geometric picture of *where* the regularized solution lands: the penalty defines a constraint region in coefficient space, and the solution is the first point where the expanding RSS contours touch that region. The shape of the region β€” the smooth :math:`L_2` disk of ridge versus the cornered :math:`L_1` diamond of the LASSO β€” determines whether coefficients merely shrink or are set exactly to zero. .. figure:: https://pqyjaywwccbnqpwgeiuv.supabase.co/storage/v1/object/public/STAT%20418%20Images/assets/Appendices/appendix_c_fig06_ridge_lasso_geometry.png :alt: RSS contour ellipses expanding until they touch the constraint region: the L2 circle (ridge) is touched away from the axes so both coefficients stay nonzero, while the L1 diamond (LASSO) is touched at a corner on an axis, producing a sparse solution. :align: center :width: 100% **Regularization geometry: Ridge vs LASSO.** RSS contour ellipses expand outward from the unconstrained OLS solution until they touch the constraint region. (a) The :math:`L_2` circle (Ridge) has a smooth boundary, so the tangent point has both :math:`\beta_1, \beta_2 \neq 0`. (b) The :math:`L_1` diamond (LASSO) has corners on the coordinate axes; the first contour to touch the diamond typically hits a corner where :math:`\beta_j = 0`, producing a sparse solution. (c) The geometric argument summarized step by step, with a note on higher dimensions: the :math:`L_1` ball in :math:`p` dimensions has :math:`2p` corners, so corner contact β€” and hence automatic variable selection β€” becomes even more likely as :math:`p` grows. Decomposition Summary ~~~~~~~~~~~~~~~~~~~~~~~ .. flat-table:: When to Use Which Decomposition :header-rows: 1 * - Decomposition - Requirements - Cost - Primary Use in This Course * - **Eigen** (:math:`\mathbf{Q}\boldsymbol{\Lambda}\mathbf{Q}^\top`) - Symmetric - :math:`O(n^3)` - PCA, Markov chain convergence, definiteness tests * - **Cholesky** (:math:`\mathbf{L}\mathbf{L}^\top`) - Symmetric PD - :math:`O(n^3/3)` - Sampling correlated normals, solving PD systems * - **QR** (:math:`\mathbf{Q}\mathbf{R}`) - Full column rank - :math:`O(2np^2)` for thin QR - Numerically stable regression, leverage * - **SVD** (:math:`\mathbf{U}\boldsymbol{\Sigma}\mathbf{V}^\top`) - Any matrix - :math:`O(\min(mn^2, m^2n))` - Ridge regression, condition number, rank determination Quadratic Forms and Covariance -------------------------------- Quadratic forms β€” expressions of the form :math:`\mathbf{x}^\top\mathbf{A}\mathbf{x}` β€” are ubiquitous in statistics. They appear in the multivariate normal density, in sum-of-squares decompositions, in the chi-square distribution, and in every optimization problem involving least squares. Quadratic Forms ~~~~~~~~~~~~~~~~ For a symmetric matrix :math:`\mathbf{A} \in \mathbb{R}^{n \times n}` and vector :math:`\mathbf{x} \in \mathbb{R}^n`: .. math:: Q(\mathbf{x}) = \mathbf{x}^\top \mathbf{A} \mathbf{x} = \sum_{i=1}^n \sum_{j=1}^n A_{ij} x_i x_j The sign behavior of :math:`Q` is determined by the definiteness of :math:`\mathbf{A}`: * :math:`\mathbf{A}` positive definite :math:`\Rightarrow Q(\mathbf{x}) > 0` for all :math:`\mathbf{x} \neq \mathbf{0}` (bowl opening upward) * :math:`\mathbf{A}` negative definite :math:`\Rightarrow Q(\mathbf{x}) < 0` for all :math:`\mathbf{x} \neq \mathbf{0}` (bowl opening downward) * :math:`\mathbf{A}` indefinite :math:`\Rightarrow Q` takes both positive and negative values (saddle) **Statistical connection**: The Mahalanobis distance :math:`(\mathbf{x} - \boldsymbol{\mu})^\top \boldsymbol{\Sigma}^{-1} (\mathbf{x} - \boldsymbol{\mu})` in the multivariate normal density is a quadratic form in :math:`\boldsymbol{\Sigma}^{-1}`. Its level sets are ellipsoids whose axes align with the eigenvectors of :math:`\boldsymbol{\Sigma}`. **Chi-square connection**: If :math:`\mathbf{Z} \sim \mathcal{N}(\mathbf{0}, \mathbf{I}_p)`, then :math:`\mathbf{Z}^\top\mathbf{Z} = \sum_{i=1}^p Z_i^2 \sim \chi^2_p`. More generally, if :math:`\mathbf{P}` is a symmetric idempotent matrix of rank :math:`r`, then :math:`\mathbf{Z}^\top\mathbf{P}\mathbf{Z} \sim \chi^2_r`. This is the basis for the chi-square distribution of RSS/:math:`\sigma^2` in linear models. Covariance Matrices ~~~~~~~~~~~~~~~~~~~~ .. admonition:: Definition :class: definition The **covariance matrix** of a random vector :math:`\mathbf{X} = (X_1, \ldots, X_p)^\top` is: .. math:: \boldsymbol{\Sigma} = \text{Var}(\mathbf{X}) = \mathbb{E}[(\mathbf{X} - \boldsymbol{\mu})(\mathbf{X} - \boldsymbol{\mu})^\top] where :math:`\Sigma_{ij} = \text{Cov}(X_i, X_j)` and :math:`\boldsymbol{\mu} = \mathbb{E}[\mathbf{X}]`. Every covariance matrix is symmetric and positive semi-definite (PSD). It is PD if and only if no component is a deterministic linear combination of others. **Variance of linear combinations.** For a constant matrix :math:`\mathbf{A}` and random vector :math:`\mathbf{X}`: .. math:: \text{Var}(\mathbf{A}\mathbf{X}) = \mathbf{A} \text{Var}(\mathbf{X}) \mathbf{A}^\top This formula propagates uncertainty through linear transformations and is the matrix foundation for: * The variance of the OLS estimator: :math:`\text{Var}(\hat{\boldsymbol{\beta}}) = \sigma^2 (\mathbf{X}^\top\mathbf{X})^{-1}` * The sandwich estimator for robust variance: :math:`(\mathbf{X}^\top\mathbf{X})^{-1}\mathbf{X}^\top\text{diag}(e_i^2)\mathbf{X}(\mathbf{X}^\top\mathbf{X})^{-1}` * The multivariate delta method: :math:`\text{Var}(g(\hat{\boldsymbol{\theta}})) \approx \mathbf{J} \text{Var}(\hat{\boldsymbol{\theta}}) \mathbf{J}^\top` .. admonition:: Derivation: Variance of OLS Estimator :class: proof Under the model :math:`\mathbf{y} = \mathbf{X}\boldsymbol{\beta} + \boldsymbol{\varepsilon}` with :math:`\text{Var}(\boldsymbol{\varepsilon}) = \sigma^2 \mathbf{I}`: .. math:: \text{Var}(\hat{\boldsymbol{\beta}}) = \text{Var}\!\left((\mathbf{X}^\top\mathbf{X})^{-1}\mathbf{X}^\top\mathbf{y}\right) = (\mathbf{X}^\top\mathbf{X})^{-1}\mathbf{X}^\top \cdot \sigma^2\mathbf{I} \cdot \mathbf{X}(\mathbf{X}^\top\mathbf{X})^{-1} = \sigma^2(\mathbf{X}^\top\mathbf{X})^{-1} using the :math:`\text{Var}(\mathbf{A}\mathbf{X}) = \mathbf{A}\text{Var}(\mathbf{X})\mathbf{A}^\top` rule with :math:`\mathbf{A} = (\mathbf{X}^\top\mathbf{X})^{-1}\mathbf{X}^\top`. .. code-block:: python import numpy as np rng = np.random.default_rng(42) n, p = 1000, 3 true_beta = np.array([1, 2, -1]) sigma = 0.5 X = rng.standard_normal((n, p)) y = X @ true_beta + sigma * rng.standard_normal(n) # OLS and its variance XtX_inv = np.linalg.inv(X.T @ X) beta_hat = XtX_inv @ X.T @ y s2 = np.sum((y - X @ beta_hat)**2) / (n - p) var_beta = s2 * XtX_inv print(f"Estimated beta: {beta_hat.round(4)}") print(f"Standard errors: {np.sqrt(np.diag(var_beta)).round(4)}") .. _matrix-calculus-section: Matrix Calculus ---------------- Optimization-based inference β€” MLE, MAP estimation, Fisher scoring β€” requires taking derivatives of scalar functions with respect to vectors and matrices. Matrix calculus provides compact notation for these operations. Gradients of Scalar Functions ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ For a scalar-valued function :math:`f: \mathbb{R}^p \to \mathbb{R}`, the **gradient** is the column vector of partial derivatives: .. math:: \nabla_{\boldsymbol{\theta}} f = \frac{\partial f}{\partial \boldsymbol{\theta}} = \begin{pmatrix} \partial f / \partial \theta_1 \\ \vdots \\ \partial f / \partial \theta_p \end{pmatrix} The gradient points in the direction of steepest ascent. Setting :math:`\nabla f = \mathbf{0}` finds critical points β€” the basis for all optimization-based estimation. **Key gradient identities** (for constant :math:`\mathbf{a}`, :math:`\mathbf{b}`, and symmetric :math:`\mathbf{A}`): .. math:: \nabla_{\mathbf{x}} (\mathbf{a}^\top \mathbf{x}) &= \mathbf{a} \\ \nabla_{\mathbf{x}} (\mathbf{x}^\top \mathbf{A} \mathbf{x}) &= 2\mathbf{A}\mathbf{x} \\ \nabla_{\mathbf{x}} (\mathbf{x}^\top \mathbf{a}) &= \mathbf{a} \\ \nabla_{\mathbf{x}} (\mathbf{b}^\top \mathbf{A} \mathbf{x}) &= \mathbf{A}^\top \mathbf{b} .. admonition:: Derivation: Gradient of a Quadratic Form :class: proof For symmetric :math:`\mathbf{A}`, write out :math:`f(\mathbf{x}) = \mathbf{x}^\top\mathbf{A}\mathbf{x} = \sum_i \sum_j A_{ij} x_i x_j`. Then: .. math:: \frac{\partial f}{\partial x_k} = \sum_j A_{kj} x_j + \sum_i A_{ik} x_i = 2 \sum_j A_{kj} x_j where the last equality uses :math:`A_{ik} = A_{ki}` (symmetry). In matrix notation, this is :math:`2\mathbf{A}\mathbf{x}`. The Hessian Matrix ~~~~~~~~~~~~~~~~~~~ The **Hessian** is the matrix of second partial derivatives: .. math:: \mathbf{H}_f(\boldsymbol{\theta}) = \nabla^2 f = \begin{pmatrix} \frac{\partial^2 f}{\partial \theta_1^2} & \cdots & \frac{\partial^2 f}{\partial \theta_1 \partial \theta_p} \\ \vdots & \ddots & \vdots \\ \frac{\partial^2 f}{\partial \theta_p \partial \theta_1} & \cdots & \frac{\partial^2 f}{\partial \theta_p^2} \end{pmatrix} The Hessian is always symmetric (by equality of mixed partials for smooth functions). At a critical point :math:`\boldsymbol{\theta}^*`: * :math:`\mathbf{H}` negative definite :math:`\Rightarrow` local maximum (used to verify MLEs) * :math:`\mathbf{H}` positive definite :math:`\Rightarrow` local minimum In MLE, the **observed Fisher information** is :math:`\mathbf{J}(\hat{\boldsymbol{\theta}}) = -\mathbf{H}_\ell(\hat{\boldsymbol{\theta}})` β€” the negative Hessian of the log-likelihood evaluated at the MLE. Its inverse estimates the covariance of :math:`\hat{\boldsymbol{\theta}}` (see :ref:`ch3_2-maximum-likelihood-estimation`). Derivative of Log-Determinant ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ For a positive definite matrix :math:`\mathbf{A}(\boldsymbol{\theta})` that depends on parameters: .. math:: \frac{\partial}{\partial \theta_k} \log \det(\mathbf{A}) = \text{tr}\!\left(\mathbf{A}^{-1} \frac{\partial \mathbf{A}}{\partial \theta_k}\right) This identity appears in ML estimation for linear models (differentiating the normal log-likelihood with respect to variance parameters) and in computing the Fisher information for multivariate models. .. _jacobian-section: Jacobian and Change of Variables ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ .. admonition:: Definition :class: definition The **Jacobian matrix** of a vector-valued function :math:`\mathbf{g}: \mathbb{R}^p \to \mathbb{R}^q` is: .. math:: \mathbf{J}_{\mathbf{g}}(\mathbf{x}) = \frac{\partial \mathbf{g}}{\partial \mathbf{x}^\top} = \begin{pmatrix} \partial g_1/\partial x_1 & \cdots & \partial g_1/\partial x_p \\ \vdots & \ddots & \vdots \\ \partial g_q/\partial x_1 & \cdots & \partial g_q/\partial x_p \end{pmatrix} The Jacobian plays two roles in this course: 1. **Change of variables in densities**: If :math:`\mathbf{Y} = \mathbf{g}(\mathbf{X})` where :math:`\mathbf{g}` is a bijection, then: .. math:: f_{\mathbf{Y}}(\mathbf{y}) = f_{\mathbf{X}}(\mathbf{g}^{-1}(\mathbf{y})) \cdot \left|\det \mathbf{J}_{\mathbf{g}^{-1}}(\mathbf{y})\right| This is essential for deriving distributions of transformed random vectors (see :ref:`ch2.4-transformation-methods`) and for constructing Jeffreys priors under reparameterization (see :ref:`ch5_2-prior-distributions`). 2. **Multivariate delta method**: For an estimator :math:`\hat{\boldsymbol{\theta}} \xrightarrow{d} \mathcal{N}(\boldsymbol{\theta}, \boldsymbol{\Sigma}/n)` and a smooth function :math:`\mathbf{g}`: .. math:: \mathbf{g}(\hat{\boldsymbol{\theta}}) \xrightarrow{d} \mathcal{N}\!\left(\mathbf{g}(\boldsymbol{\theta}),\; \mathbf{J}_{\mathbf{g}}(\boldsymbol{\theta}) \frac{\boldsymbol{\Sigma}}{n} \mathbf{J}_{\mathbf{g}}(\boldsymbol{\theta})^\top\right) See :ref:`ch3_3-sampling-variability` for the full development. Numerical Considerations -------------------------- The formulas in this appendix are exact in real arithmetic, but computers compute in finite-precision floating point, where mathematically equivalent algorithms can differ enormously in accuracy. This section introduces the condition number β€” the standard measure of how much a problem amplifies small errors β€” and the practical rules it implies for statistical computation. Condition Number and Stability ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ The **condition number** of a matrix :math:`\mathbf{A}` measures how sensitive the solution of :math:`\mathbf{A}\mathbf{x} = \mathbf{b}` is to perturbations in :math:`\mathbf{A}` or :math:`\mathbf{b}`: .. math:: \kappa(\mathbf{A}) = \|\mathbf{A}\| \cdot \|\mathbf{A}^{-1}\| = \frac{\sigma_{\max}}{\sigma_{\min}} where :math:`\sigma_{\max}` and :math:`\sigma_{\min}` are the largest and smallest singular values. A relative perturbation of size :math:`\epsilon` in the data can cause a relative perturbation of up to :math:`\kappa \cdot \epsilon` in the solution. Rules of thumb: * :math:`\kappa \approx 1`: Well-conditioned (orthogonal matrices have :math:`\kappa = 1`) * :math:`\kappa \approx 10^k`: Expect to lose about :math:`k` digits of accuracy * :math:`\kappa > 10^{15}`: Effectively singular in double precision (:math:`\approx 16` digits) When :math:`\kappa(\mathbf{X})` is large (due to near-collinear predictors), forming :math:`\mathbf{X}^\top\mathbf{X}` squares the condition number to :math:`\kappa^2` β€” potentially catastrophic (see :ref:`Appendix C ` for how floating-point precision and condition numbers interact to determine digits of accuracy lost). This is why numerical linear algebra avoids :math:`\mathbf{X}^\top\mathbf{X}` and instead uses QR or SVD. .. figure:: https://pqyjaywwccbnqpwgeiuv.supabase.co/storage/v1/object/public/STAT%20418%20Images/assets/Appendices/appendix_c_fig05_condition_number.png :alt: Three panels contrasting a well-conditioned system, where small perturbations of b barely move the solution, with an ill-conditioned system, where the same perturbations scatter the solution widely, plus the condition-number bound on worst-case error amplification. :align: center :width: 100% **Condition number and perturbation sensitivity.** (a) A well-conditioned system: small perturbations in :math:`\mathbf{b}` cause small changes in the solution. (b) An ill-conditioned system: the same perturbations cause the solution to scatter wildly. (c) The error amplification bound: the condition number :math:`\kappa` multiplies input perturbations to give the worst-case output error. Avoiding :math:`\mathbf{X}^\top\mathbf{X}` ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ The following operations should use decompositions rather than forming :math:`\mathbf{X}^\top\mathbf{X}` explicitly: .. flat-table:: Numerical Best Practices :header-rows: 1 * - Task - Naive (Avoid) - Stable (Prefer) * - Solve :math:`\mathbf{X}^\top\mathbf{X}\boldsymbol{\beta} = \mathbf{X}^\top\mathbf{y}` - ``inv(X.T @ X) @ X.T @ y`` - ``np.linalg.lstsq(X, y)`` (uses SVD internally) * - Compute leverage :math:`h_{ii}` - ``diag(X @ inv(X.T @ X) @ X.T)`` - ``Q, R = qr(X); sum(Q**2, axis=1)`` * - Solve PD system :math:`\mathbf{A}\mathbf{x} = \mathbf{b}` - ``inv(A) @ b`` - ``np.linalg.solve(A, b)`` or ``cho_solve(cho_factor(A), b)`` Near-Singular Matrices ~~~~~~~~~~~~~~~~~~~~~~~~ When a covariance matrix is theoretically PD but numerically near-singular (e.g., due to highly correlated variables or limited floating-point precision), the Cholesky decomposition may fail. Common remedies: * **Jitter**: Add a small multiple of the identity: :math:`\boldsymbol{\Sigma} + \epsilon \mathbf{I}` with :math:`\epsilon \sim 10^{-6}`. This nudges all eigenvalues away from zero. * **Regularization**: Use ridge-type shrinkage toward the identity: :math:`(1-\alpha)\boldsymbol{\Sigma} + \alpha \mathbf{I}` * **Pivoted Cholesky**: Detects and handles rank deficiency gracefully .. code-block:: python import numpy as np # Ill-conditioned design matrix rng = np.random.default_rng(42) X = rng.standard_normal((100, 5)) X[:, 4] = X[:, 3] + 1e-8 * rng.standard_normal(100) # nearly collinear print(f"Condition number of X: {np.linalg.cond(X):.2e}") print(f"Condition number of X'X: {np.linalg.cond(X.T @ X):.2e}") # squared! # QR is stable even here Q, R = np.linalg.qr(X) y = rng.standard_normal(100) beta = np.linalg.solve(R, Q.T @ y) # works fine Key Takeaways -------------- .. admonition:: Key Takeaways πŸ“ :class: important 1. **Matrices are linear transformations**, not just arrays of numbers. Reading :math:`\mathbf{H}\mathbf{y}` as "project :math:`\mathbf{y}` onto the column space" is more useful than computing entry by entry. 2. **Special structure enables shortcuts**: Symmetric β†’ real eigenvalues; PD β†’ Cholesky; idempotent β†’ eigenvalues in {0,1}; block diagonal β†’ invert each block independently. 3. **Block matrix algebra** (Schur complement, Sherman-Morrison-Woodbury) turns expensive :math:`n \times n` problems into cheaper :math:`k \times k` problems when structure is present. 4. **Decompositions reveal structure**: Eigen shows principal directions; Cholesky enables sampling; QR gives numerical stability; SVD handles everything else (rank, condition, regularization). 5. **Variance propagates through linear transformations** by :math:`\text{Var}(\mathbf{A}\mathbf{X}) = \mathbf{A}\text{Var}(\mathbf{X})\mathbf{A}^\top` β€” the single rule behind the OLS variance :math:`\sigma^2(\mathbf{X}^\top\mathbf{X})^{-1}`, the delta method, and Cholesky-based sampling of correlated normals. 6. **Never form** :math:`\mathbf{X}^\top\mathbf{X}` **when you can avoid it**. Use QR or SVD for regression. Use ``solve`` instead of ``inv``. Use Cholesky for PD systems. The algorithms are faster *and* more accurate. 7. **Matrix calculus** is the language of multivariate optimization: the gradient finds critical points, the Hessian classifies them, and the Jacobian propagates uncertainty through transformations. Looking Ahead -------------- The linear algebra developed here supports multiple threads in the main course: * **Chapters 3-4**: The hat matrix, projection geometry, QR decomposition, and Sherman-Morrison-Woodbury formula are the computational backbone of linear models, influence diagnostics, and cross-validation shortcuts. * **Chapter 5**: Stochastic matrices and eigendecomposition govern Markov chain convergence, Cholesky decomposition enables correlated proposals in MCMC, and the mass matrix in HMC is a covariance-scaled inner product. * **Throughout**: Matrix calculus (gradients, Hessians, Jacobians) is the shared language of Fisher information, Newton-Raphson optimization, the delta method, and automatic differentiation. Practice Problems ------------------ These exercises connect the linear algebra concepts from this appendix to their statistical applications, combining mathematical derivations with computational verification. .. admonition:: Exercise 1: Projection Geometry and the Hat Matrix :class: exercise In linear regression, the hat matrix :math:`\mathbf{H} = \mathbf{X}(\mathbf{X}^\top\mathbf{X})^{-1}\mathbf{X}^\top` projects the response vector onto the column space of :math:`\mathbf{X}`. This exercise explores its geometric and statistical properties. a. Given a design matrix :math:`\mathbf{X}` (:math:`n=50`, :math:`p=3` with intercept + 2 predictors), compute :math:`\mathbf{H} = \mathbf{X}(\mathbf{X}^\top\mathbf{X})^{-1}\mathbf{X}^\top`. Prove mathematically that :math:`\mathbf{H}` is symmetric and idempotent, then verify computationally. .. admonition:: Hint: Symmetry and Idempotency :class: tip For symmetry, take the transpose and use :math:`(\mathbf{A}\mathbf{B})^\top = \mathbf{B}^\top\mathbf{A}^\top`. For idempotency, expand :math:`\mathbf{H}^2` and simplify using the fact that :math:`(\mathbf{X}^\top\mathbf{X})^{-1}\mathbf{X}^\top\mathbf{X} = \mathbf{I}`. b. Show that the diagonal entries :math:`h_{ii}` (leverage values) satisfy :math:`1/n \leq h_{ii} \leq 1`, and that they sum to :math:`p`. Compute leverage for your :math:`\mathbf{X}` and identify the highest-leverage observation. Explain geometrically why leverage measures "distance from the center of predictor space." .. admonition:: Hint: Leverage Bounds :class: tip :math:`h_{ii} = \mathbf{x}_i^\top(\mathbf{X}^\top\mathbf{X})^{-1}\mathbf{x}_i` is a quadratic form. The bounds come from :math:`\mathbf{H}` being idempotent (eigenvalues 0 or 1) and the trace equaling :math:`p`. Since :math:`\text{tr}(\mathbf{H}) = p` and :math:`0 \leq h_{ii} \leq 1`, the average leverage is :math:`p/n`. c. Add an outlier at a high-leverage point: set one observation's predictors to extreme values and its response to an unusual value. Show how the hat matrix concentrates influence β€” compare the fitted value at the outlier with and without using the hat matrix to quantify how much the outlier "pulls" the fit toward itself. .. admonition:: Hint: Influence at High-Leverage Points :class: tip For a high-leverage point, :math:`h_{ii}` is close to 1, meaning :math:`\hat{y}_i \approx y_i` β€” the fit is forced through that point regardless of the other data. This is because :math:`\hat{y}_i = h_{ii} y_i + \sum_{j \neq i} h_{ij} y_j`, and when :math:`h_{ii} \approx 1`, the first term dominates. d. Verify the fundamental orthogonality: :math:`\mathbf{X}^\top\mathbf{e} = \mathbf{0}` where :math:`\mathbf{e} = (\mathbf{I} - \mathbf{H})\mathbf{y}`. Interpret geometrically: the residual vector is perpendicular to every column of :math:`\mathbf{X}`. .. admonition:: Hint: Orthogonality of Residuals :class: tip Expand :math:`\mathbf{X}^\top\mathbf{e} = \mathbf{X}^\top(\mathbf{I} - \mathbf{H})\mathbf{y} = \mathbf{X}^\top\mathbf{y} - \mathbf{X}^\top\mathbf{H}\mathbf{y}`. Then substitute :math:`\mathbf{H} = \mathbf{X}(\mathbf{X}^\top\mathbf{X})^{-1}\mathbf{X}^\top` and simplify: :math:`\mathbf{X}^\top\mathbf{H} = \mathbf{X}^\top\mathbf{X}(\mathbf{X}^\top\mathbf{X})^{-1}\mathbf{X}^\top = \mathbf{X}^\top`. .. dropdown:: Solution :class-container: solution **Part (a): Symmetry and Idempotency β€” Mathematical Proof** **Symmetry:** .. math:: \mathbf{H}^\top &= \left[\mathbf{X}(\mathbf{X}^\top\mathbf{X})^{-1}\mathbf{X}^\top\right]^\top \\ &= (\mathbf{X}^\top)^\top \left[(\mathbf{X}^\top\mathbf{X})^{-1}\right]^\top \mathbf{X}^\top \\ &= \mathbf{X} \left[(\mathbf{X}^\top\mathbf{X})^\top\right]^{-1} \mathbf{X}^\top \\ &= \mathbf{X} (\mathbf{X}^\top\mathbf{X})^{-1} \mathbf{X}^\top = \mathbf{H} where we used :math:`(\mathbf{X}^\top\mathbf{X})^\top = \mathbf{X}^\top\mathbf{X}` (symmetric matrix) and :math:`(\mathbf{A}^{-1})^\top = (\mathbf{A}^\top)^{-1}`. **Idempotency:** .. math:: \mathbf{H}^2 &= \mathbf{X}(\mathbf{X}^\top\mathbf{X})^{-1}\mathbf{X}^\top \cdot \mathbf{X}(\mathbf{X}^\top\mathbf{X})^{-1}\mathbf{X}^\top \\ &= \mathbf{X}(\mathbf{X}^\top\mathbf{X})^{-1} \underbrace{(\mathbf{X}^\top\mathbf{X})(\mathbf{X}^\top\mathbf{X})^{-1}}_{\mathbf{I}} \mathbf{X}^\top \\ &= \mathbf{X}(\mathbf{X}^\top\mathbf{X})^{-1}\mathbf{X}^\top = \mathbf{H} **Computational Verification:** .. code-block:: python import numpy as np rng = np.random.default_rng(seed=42) # Design matrix: intercept + 2 predictors, n=50, p=3 n, p = 50, 3 X = np.column_stack([ np.ones(n), rng.standard_normal(n), rng.standard_normal(n) ]) # Hat matrix H = X @ np.linalg.solve(X.T @ X, X.T) # Verify symmetry: H = H^T sym_error = np.max(np.abs(H - H.T)) print(f"Symmetry check: max|H - H^T| = {sym_error:.2e}") # Verify idempotency: H^2 = H idem_error = np.max(np.abs(H @ H - H)) print(f"Idempotency check: max|H^2 - H| = {idem_error:.2e}") # Eigenvalues should be 0 or 1 eigvals = np.linalg.eigvalsh(H) print(f"\nEigenvalues of H (sorted):") print(f" Number near 0: {np.sum(np.abs(eigvals) < 1e-10)}") print(f" Number near 1: {np.sum(np.abs(eigvals - 1) < 1e-10)}") print(f" Trace(H) = sum of eigenvalues = {np.trace(H):.6f} (should be p={p})") .. code-block:: text Symmetry check: max|H - H^T| = 2.78e-17 Idempotency check: max|H^2 - H| = 4.16e-17 Eigenvalues of H (sorted): Number near 0: 47 Number near 1: 3 Trace(H) = sum of eigenvalues = 3.000000 (should be p=3) .. raw:: html
**Part (b): Leverage Values** Since :math:`\text{tr}(\mathbf{H}) = p` and :math:`\mathbf{H}` is idempotent with eigenvalues in :math:`\{0, 1\}`, each diagonal satisfies :math:`0 \leq h_{ii} \leq 1`. When :math:`\mathbf{X}` includes an intercept column, we additionally have :math:`h_{ii} \geq 1/n` because the intercept contribution alone gives :math:`1/n`. .. code-block:: python import numpy as np rng = np.random.default_rng(seed=42) n, p = 50, 3 X = np.column_stack([ np.ones(n), rng.standard_normal(n), rng.standard_normal(n) ]) H = X @ np.linalg.solve(X.T @ X, X.T) leverages = np.diag(H) print(f"Leverage statistics:") print(f" Sum of leverages: {np.sum(leverages):.6f} (should be p={p})") print(f" Mean leverage: {np.mean(leverages):.6f} (should be p/n={p/n:.4f})") print(f" Min leverage: {np.min(leverages):.6f} (lower bound 1/n={1/n:.4f})") print(f" Max leverage: {np.max(leverages):.6f} (upper bound 1)") print(f"\nHighest-leverage observation:") i_max = np.argmax(leverages) print(f" Index: {i_max}") print(f" Leverage h_ii: {leverages[i_max]:.6f}") print(f" Predictor values: x1={X[i_max, 1]:.4f}, x2={X[i_max, 2]:.4f}") print(f" Distance from predictor centroid: {np.sqrt(np.sum((X[i_max, 1:] - X[:, 1:].mean(axis=0))**2)):.4f}") .. code-block:: text Leverage statistics: Sum of leverages: 3.000000 (should be p=3) Mean leverage: 0.060000 (should be p/n=0.0600) Min leverage: 0.020281 (lower bound 1/n=0.0200) Max leverage: 0.183434 (upper bound 1) Highest-leverage observation: Index: 30 Leverage h_ii: 0.183434 Predictor values: x1=2.1416, x2=0.4568 Distance from predictor centroid: 2.1506 The highest-leverage point is the one farthest from the centroid of the predictor space, confirming the geometric interpretation: leverage measures how "unusual" an observation's predictor values are. .. raw:: html
**Part (c): Outlier at a High-Leverage Point** .. code-block:: python import numpy as np rng = np.random.default_rng(seed=42) n, p = 50, 3 X = np.column_stack([ np.ones(n), rng.standard_normal(n), rng.standard_normal(n) ]) beta_true = np.array([2.0, -1.5, 0.8]) y = X @ beta_true + 0.5 * rng.standard_normal(n) # Create a high-leverage outlier: extreme predictor values, unusual response X_outlier = X.copy() y_outlier = y.copy() X_outlier[0, 1] = 8.0 # Far from center X_outlier[0, 2] = 8.0 y_outlier[0] = 50.0 # Unusual response # Compute hat matrix with the outlier H_out = X_outlier @ np.linalg.solve(X_outlier.T @ X_outlier, X_outlier.T) leverages_out = np.diag(H_out) print(f"Leverage of outlier point: h_00 = {leverages_out[0]:.6f}") print(f"Next highest leverage: {np.sort(leverages_out)[-2]:.6f}") # Fitted values beta_hat = np.linalg.solve(X_outlier.T @ X_outlier, X_outlier.T @ y_outlier) y_hat = X_outlier @ beta_hat print(f"\nOutlier: y_0 = {y_outlier[0]:.2f}, y_hat_0 = {y_hat[0]:.4f}") print(f"Ratio y_hat_0 / y_0 = {y_hat[0] / y_outlier[0]:.4f}") print(f"h_00 = {leverages_out[0]:.4f} (close to ratio above)") print(f"\nInterpretation: since h_00 β‰ˆ {leverages_out[0]:.3f}, the fit is") print(f"forced {100*leverages_out[0]:.1f}% of the way toward the outlier's y-value.") .. code-block:: text Leverage of outlier point: h_00 = 0.825435 Next highest leverage: 0.109281 Outlier: y_0 = 50.00, y_hat_0 = 40.8597 Ratio y_hat_0 / y_0 = 0.8172 h_00 = 0.8254 (close to ratio above) Interpretation: since h_00 β‰ˆ 0.825, the fit is forced 82.5% of the way toward the outlier's y-value. With :math:`h_{ii} \approx 0.83`, the regression is forced mostly through the outlier regardless of the other 49 observations. This is the danger of high-leverage points: they can dominate the fit. .. raw:: html
**Part (d): Orthogonality of Residuals** **Proof:** :math:`\mathbf{X}^\top\mathbf{e} = \mathbf{X}^\top(\mathbf{I} - \mathbf{H})\mathbf{y} = \mathbf{X}^\top\mathbf{y} - \mathbf{X}^\top\mathbf{H}\mathbf{y}`. Substituting :math:`\mathbf{H}`: .. math:: \mathbf{X}^\top\mathbf{H} = \mathbf{X}^\top\mathbf{X}(\mathbf{X}^\top\mathbf{X})^{-1}\mathbf{X}^\top = \mathbf{X}^\top Therefore :math:`\mathbf{X}^\top\mathbf{e} = \mathbf{X}^\top\mathbf{y} - \mathbf{X}^\top\mathbf{y} = \mathbf{0}`. **Geometric interpretation:** The residual vector :math:`\mathbf{e}` lives in the orthogonal complement of :math:`\text{col}(\mathbf{X})`. It is perpendicular to every column of :math:`\mathbf{X}`, including the intercept column (which forces :math:`\sum e_i = 0`). .. code-block:: python import numpy as np rng = np.random.default_rng(seed=42) n, p = 50, 3 X = np.column_stack([ np.ones(n), rng.standard_normal(n), rng.standard_normal(n) ]) beta_true = np.array([2.0, -1.5, 0.8]) y = X @ beta_true + 0.5 * rng.standard_normal(n) # Compute hat matrix and residuals H = X @ np.linalg.solve(X.T @ X, X.T) y_hat = H @ y e = y - y_hat # equivalently, (I - H) @ y # Verify orthogonality ortho_check = X.T @ e print("X^T @ e (should be zero vector):") print(f" {ortho_check}") print(f" Max absolute value: {np.max(np.abs(ortho_check)):.2e}") # Consequence: residuals sum to zero (orthogonal to intercept column) print(f"\nSum of residuals: {np.sum(e):.2e} (orthogonal to ones column)") print(f"Correlation of residuals with x1: {np.corrcoef(X[:, 1], e)[0, 1]:.2e}") print(f"Correlation of residuals with x2: {np.corrcoef(X[:, 2], e)[0, 1]:.2e}") .. code-block:: text X^T @ e (should be zero vector): [ 4.44089210e-15 -1.50920942e-15 2.66453526e-15] Max absolute value: 4.44e-15 Sum of residuals: 4.44e-15 (orthogonal to ones column) Correlation of residuals with x1: -9.63e-17 Correlation of residuals with x2: 1.95e-16 The residuals are orthogonal to the column space of :math:`\mathbf{X}` to machine precision, confirming the projection geometry. .. admonition:: Exercise 2: Matrix Decompositions for Ill-Conditioned Regression :class: exercise When predictors are nearly collinear, the normal equations become numerically unstable. This exercise compares decomposition-based approaches and introduces ridge regularization through the SVD lens. a. Create an ill-conditioned design matrix: generate :math:`\mathbf{X}` (:math:`n=100`, :math:`p=5`) with ``rng.standard_normal``, then set ``X[:,4] = X[:,3] + 1e-6 * rng.standard_normal(100)`` to create near-collinearity. Compute :math:`\kappa(\mathbf{X})` and :math:`\kappa(\mathbf{X}^\top\mathbf{X})` and verify the squaring relationship. .. admonition:: Hint: Condition Number Squaring :class: tip ``np.linalg.cond()`` computes the condition number. For well-conditioned :math:`\mathbf{X}`, :math:`\kappa(\mathbf{X}^\top\mathbf{X}) \approx \kappa(\mathbf{X})^2`. This is because the singular values of :math:`\mathbf{X}^\top\mathbf{X}` are the squares of the singular values of :math:`\mathbf{X}`. b. Generate :math:`\mathbf{y} = \mathbf{X}\boldsymbol{\beta} + \boldsymbol{\varepsilon}` with known :math:`\boldsymbol{\beta} = [1, -2, 1.5, 0.5, -0.3]^\top` and solve OLS three ways: (1) Normal equations via ``np.linalg.inv(X.T @ X) @ X.T @ y``, (2) QR decomposition, (3) ``np.linalg.lstsq``. Compare the solutions β€” does any method recover :math:`\boldsymbol{\beta}` accurately? Explain why not. .. admonition:: Hint: QR Solution Method :class: tip For QR, factor :math:`\mathbf{X} = \mathbf{Q}\mathbf{R}`, then :math:`\hat{\boldsymbol{\beta}} = \mathbf{R}^{-1}\mathbf{Q}^\top\mathbf{y}` via ``np.linalg.solve(R, Q.T @ y)``. ``lstsq`` uses SVD internally and is the most robust. c. Apply ridge regression via the SVD: compute :math:`\mathbf{X} = \mathbf{U}\boldsymbol{\Sigma}\mathbf{V}^\top` and show that :math:`\hat{\boldsymbol{\beta}}_{\text{ridge}} = \mathbf{V} \text{diag}\left(\frac{\sigma_i}{\sigma_i^2 + \lambda}\right) \mathbf{U}^\top\mathbf{y}`. For :math:`\lambda \in \{0.001, 0.1, 1, 10\}`, compute the shrinkage factors and effective degrees of freedom :math:`\text{df}(\lambda) = \sum_i \frac{\sigma_i^2}{\sigma_i^2 + \lambda}`. .. admonition:: Hint: SVD Shrinkage Geometry :class: tip Small singular values (the near-collinear directions) get shrunk most aggressively. This is the geometric insight: ridge regression stabilizes by damping the directions where :math:`\mathbf{X}` has little information. The shrinkage factor :math:`\sigma_i^2 / (\sigma_i^2 + \lambda)` is near 1 for large :math:`\sigma_i` and near 0 for small :math:`\sigma_i`. d. Demonstrate the Cholesky speed advantage: for a :math:`500 \times 500` positive definite matrix, time ``scipy.linalg.solve(A, b)`` (general LU-based) vs ``scipy.linalg.cho_solve(scipy.linalg.cho_factor(A), b)``. For solving multiple right-hand sides (e.g., 100), show that Cholesky factorize-once-solve-many is faster. .. admonition:: Hint: Cholesky Factorize-Once Strategy :class: tip Use ``import time`` for simple timing. ``cho_factor`` computes :math:`\mathbf{L}` once; ``cho_solve`` reuses it for each :math:`\mathbf{b}`. The advantage grows with the number of right-hand sides because the :math:`O(n^3)` factorization is done once rather than repeatedly. .. dropdown:: Solution :class-container: solution **Part (a): Condition Number and the Squaring Relationship** .. code-block:: python import numpy as np rng = np.random.default_rng(seed=42) n, p = 100, 5 X = rng.standard_normal((n, p)) # Create near-collinearity: column 4 β‰ˆ column 3 X[:, 4] = X[:, 3] + 1e-6 * rng.standard_normal(n) cond_X = np.linalg.cond(X) cond_XtX = np.linalg.cond(X.T @ X) print(f"Condition number of X: ΞΊ(X) = {cond_X:.4e}") print(f"Condition number of X'X: ΞΊ(X'X) = {cond_XtX:.4e}") print(f"ΞΊ(X)^2 = {cond_X**2:.4e}") print(f"Ratio ΞΊ(X'X) / ΞΊ(X)^2 = {cond_XtX / cond_X**2:.6f}") print(f"\nSingular values of X:") svs = np.linalg.svd(X, compute_uv=False) for i, sv in enumerate(svs): print(f" Οƒ_{i+1} = {sv:.6f}") print(f"\nRatio Οƒ_max/Οƒ_min = {svs[0]/svs[-1]:.4e} = ΞΊ(X)") .. code-block:: text Condition number of X: ΞΊ(X) = 2.0454e+06 Condition number of X'X: ΞΊ(X'X) = 4.1796e+12 ΞΊ(X)^2 = 4.1835e+12 Ratio ΞΊ(X'X) / ΞΊ(X)^2 = 0.999065 Singular values of X: Οƒ_1 = 14.964792 Οƒ_2 = 9.966658 Οƒ_3 = 9.128724 Οƒ_4 = 8.244767 Οƒ_5 = 0.000007 Ratio Οƒ_max/Οƒ_min = 2.0454e+06 = ΞΊ(X) The near-collinearity creates one tiny singular value (:math:`\sigma_5 \approx 7 \times 10^{-6}`), making :math:`\kappa(\mathbf{X}) \approx 2 \times 10^6`. The squaring relationship :math:`\kappa(\mathbf{X}^\top\mathbf{X}) \approx \kappa(\mathbf{X})^2` holds because the singular values of :math:`\mathbf{X}^\top\mathbf{X}` are :math:`\sigma_i^2`. .. raw:: html
**Part (b): Three OLS Methods Compared** .. code-block:: python import numpy as np rng = np.random.default_rng(seed=42) n, p = 100, 5 X = rng.standard_normal((n, p)) X[:, 4] = X[:, 3] + 1e-6 * rng.standard_normal(n) beta_true = np.array([1.0, -2.0, 1.5, 0.5, -0.3]) y = X @ beta_true + 0.1 * rng.standard_normal(n) # Method 1: Normal equations (direct inversion) beta_normal = np.linalg.inv(X.T @ X) @ X.T @ y # Method 2: QR decomposition Q, R = np.linalg.qr(X) beta_qr = np.linalg.solve(R, Q.T @ y) # Method 3: lstsq (uses SVD internally) beta_lstsq, _, _, _ = np.linalg.lstsq(X, y, rcond=None) np.set_printoptions(precision=4) print(f"True Ξ²: {beta_true}") for name, b in [("Normal equations", beta_normal), ("QR decomposition", beta_qr), ("lstsq (SVD)", beta_lstsq)]: print(f"\n{name}:") print(f" Ξ²_hat = {b}") print(f" max|Ξ²_hat - Ξ²_true| = {np.max(np.abs(b - beta_true)):.4e}") # All methods achieve the same residual norm print(f"\nResidual norms (should be identical):") for name, b in [("Normal", beta_normal), ("QR", beta_qr), ("lstsq", beta_lstsq)]: print(f" {name}: {np.linalg.norm(y - X @ b):.6f}") # The SUM beta_4 + beta_5 IS well-estimated print(f"\nΞ²β‚„ + Ξ²β‚… (identifiable combination):") print(f" True: {beta_true[3] + beta_true[4]:.4f}") print(f" All methods: {beta_normal[3] + beta_normal[4]:.4f}") .. code-block:: text True Ξ²: [ 1. -2. 1.5 0.5 -0.3] Normal equations: Ξ²_hat = [ 9.9871e-01 -1.9994e+00 1.4933e+00 -1.2616e+03 1.2618e+03] max|Ξ²_hat - Ξ²_true| = 1.2621e+03 QR decomposition: Ξ²_hat = [ 9.9871e-01 -1.9994e+00 1.4933e+00 -1.2627e+03 1.2629e+03] max|Ξ²_hat - Ξ²_true| = 1.2632e+03 lstsq (SVD): Ξ²_hat = [ 9.9871e-01 -1.9994e+00 1.4933e+00 -1.2627e+03 1.2629e+03] max|Ξ²_hat - Ξ²_true| = 1.2632e+03 Residual norms (should be identical): Normal: 1.042693 QR: 1.042693 lstsq: 1.042693 Ξ²β‚„ + Ξ²β‚… (identifiable combination): True: 0.2000 All methods: 0.1957 **Key insight:** All three methods find valid least-squares solutions with identical residual norms β€” the fit to the data is equally good. The first three coefficients (:math:`\beta_1, \beta_2, \beta_3`) are recovered accurately. But :math:`\beta_4` and :math:`\beta_5` are individually off by orders of magnitude because columns 4 and 5 of :math:`\mathbf{X}` are nearly identical: only their *sum* :math:`\beta_4 + \beta_5` is identifiable. No numerical trick can fix mathematical ill-conditioning β€” that requires regularization (part c). .. raw:: html
**Part (c): Ridge Regression via SVD** The ridge estimator :math:`\hat{\boldsymbol{\beta}}_\lambda = (\mathbf{X}^\top\mathbf{X} + \lambda\mathbf{I})^{-1}\mathbf{X}^\top\mathbf{y}` can be expressed in SVD form. With :math:`\mathbf{X} = \mathbf{U}\boldsymbol{\Sigma}\mathbf{V}^\top`: .. math:: \hat{\boldsymbol{\beta}}_\lambda = \mathbf{V} \text{diag}\left(\frac{\sigma_i}{\sigma_i^2 + \lambda}\right) \mathbf{U}^\top\mathbf{y} Each component is shrunk by the factor :math:`d_i(\lambda) = \sigma_i^2 / (\sigma_i^2 + \lambda)`. .. code-block:: python import numpy as np rng = np.random.default_rng(seed=42) n, p = 100, 5 X = rng.standard_normal((n, p)) X[:, 4] = X[:, 3] + 1e-6 * rng.standard_normal(n) beta_true = np.array([1.0, -2.0, 1.5, 0.5, -0.3]) y = X @ beta_true + 0.1 * rng.standard_normal(n) # SVD of X U, sigma, Vt = np.linalg.svd(X, full_matrices=False) V = Vt.T # OLS via lstsq (for comparison) beta_lstsq = np.linalg.lstsq(X, y, rcond=None)[0] np.set_printoptions(precision=4) print(f"Singular values: {sigma}") print(f"OLS max error: {np.max(np.abs(beta_lstsq - beta_true)):.4e}") print(f"\n{'Ξ»':<10} {'df(Ξ»)':>8} {'max|err|':>10} Shrinkage factors") print("-" * 80) lambdas = [0.001, 0.1, 1.0, 10.0] for lam in lambdas: d = sigma**2 / (sigma**2 + lam) df_lam = np.sum(d) beta_ridge = V @ np.diag(sigma / (sigma**2 + lam)) @ U.T @ y err = np.max(np.abs(beta_ridge - beta_true)) d_str = ', '.join([f'{di:.6f}' for di in d]) print(f"{lam:<10.3f} {df_lam:>8.4f} {err:>10.4e} [{d_str}]") # Compare OLS vs best ridge print(f"\nOLS Ξ²_hat: {beta_lstsq}") print(f"Ridge(Ξ»=0.001): {V @ np.diag(sigma / (sigma**2 + 0.001)) @ U.T @ y}") print(f"True Ξ²: {beta_true}") .. code-block:: text Singular values: [1.4965e+01 9.9667e+00 9.1287e+00 8.2448e+00 7.3164e-06] OLS max error: 1.2632e+03 Ξ» df(Ξ») max|err| Shrinkage factors -------------------------------------------------------------------------------- 0.001 4.0000 4.0226e-01 [0.999996, 0.999990, 0.999988, 0.999985, 0.000000] 0.100 3.9959 4.0229e-01 [0.999554, 0.998994, 0.998801, 0.998531, 0.000000] 1.000 3.9592 4.0311e-01 [0.995554, 0.990033, 0.988142, 0.985502, 0.000000] 10.000 3.6304 4.1043e-01 [0.957255, 0.908537, 0.892857, 0.871756, 0.000000] OLS Ξ²_hat: [ 9.9871e-01 -1.9994e+00 1.4933e+00 -1.2627e+03 1.2629e+03] Ridge(Ξ»=0.001): [ 0.9986 -1.9994 1.4932 0.0977 0.0979] True Ξ²: [ 1. -2. 1.5 0.5 -0.3] **Interpretation:** Even the tiniest regularization (:math:`\lambda = 0.001`) reduces the max error from 1263 to 0.40 β€” a 3000Γ— improvement. The shrinkage factor for :math:`\sigma_5 \approx 7 \times 10^{-6}` is effectively 0 for all :math:`\lambda` values, killing the unstable direction entirely. Ridge replaces the wild OLS estimates :math:`\hat\beta_4 \approx -1263, \hat\beta_5 \approx 1263` with regularized estimates near 0. The first four directions (large singular values) are barely shrunk for small :math:`\lambda`. As :math:`\lambda` increases, bias grows as stable directions also shrink. .. raw:: html
**Part (d): Cholesky Speed Advantage** .. code-block:: python import numpy as np import time from scipy.linalg import cho_factor, cho_solve, solve rng = np.random.default_rng(seed=42) # Create a 500x500 positive definite matrix M = rng.standard_normal((500, 500)) A = M.T @ M + 0.1 * np.eye(500) # Guaranteed PD # Single right-hand side b = rng.standard_normal(500) # Time scipy.linalg.solve (general LU-based) start = time.time() for _ in range(100): x1 = solve(A, b) time_solve = time.time() - start # Time Cholesky start = time.time() for _ in range(100): c, low = cho_factor(A) x2 = cho_solve((c, low), b) time_chol = time.time() - start print("Single right-hand side (100 repetitions):") print(f" scipy.linalg.solve: {time_solve:.4f}s") print(f" Cholesky: {time_chol:.4f}s") print(f" Speedup: {time_solve/time_chol:.2f}x") # Multiple right-hand sides: factorize once, solve many n_rhs = 100 B = rng.standard_normal((500, n_rhs)) # General solve for each column start = time.time() for i in range(n_rhs): x = solve(A, B[:, i]) time_solve_multi = time.time() - start # Cholesky: factorize once, solve many start = time.time() c, low = cho_factor(A) for i in range(n_rhs): x = cho_solve((c, low), B[:, i]) time_chol_multi = time.time() - start print(f"\n100 right-hand sides (factorize once vs. solve each):") print(f" scipy.linalg.solve (each): {time_solve_multi:.4f}s") print(f" Cholesky (factor once): {time_chol_multi:.4f}s") print(f" Speedup: {time_solve_multi/time_chol_multi:.2f}x") print(f"\nSolutions agree: {np.allclose(solve(A, B[:, 0]), cho_solve((c, low), B[:, 0]))}") .. code-block:: text Single right-hand side (100 repetitions): scipy.linalg.solve: 0.2806s Cholesky: 0.0745s Speedup: 3.77x 100 right-hand sides (factorize once vs. solve each): scipy.linalg.solve (each): 0.2911s Cholesky (factor once): 0.0151s Speedup: 19.29x Solutions agree: True **Key insight:** For a single solve, Cholesky is roughly 3–4x faster because it exploits symmetry (:math:`n^3/3` vs :math:`2n^3/3` flops for LU, plus reduced pivoting overhead). But the real advantage is the factorize-once-solve-many pattern: for 100 right-hand sides, the Cholesky factorization happens once, and each subsequent triangular solve is only :math:`O(n^2)`. Generic ``solve`` re-factors each time, giving a ~20x speedup. .. admonition:: Exercise 3: Block Matrices and Conditional Distributions :class: exercise Block matrix algebra connects directly to conditional distributions in the multivariate normal. This exercise derives the conditional formulas from the precision matrix and verifies them computationally, then applies the Sherman-Morrison-Woodbury formula to leave-one-out cross-validation. a. For the multivariate normal with :math:`\boldsymbol{\mu} = [\boldsymbol{\mu}_1, \boldsymbol{\mu}_2]^\top` and :math:`\boldsymbol{\Sigma} = \begin{bmatrix} \boldsymbol{\Sigma}_{11} & \boldsymbol{\Sigma}_{12} \\ \boldsymbol{\Sigma}_{21} & \boldsymbol{\Sigma}_{22} \end{bmatrix}`, derive the conditional distribution :math:`\mathbf{X}_1 | \mathbf{X}_2 = \mathbf{x}_2` using block matrix inversion of :math:`\boldsymbol{\Sigma}`. Show that the conditional mean is :math:`\boldsymbol{\mu}_1 + \boldsymbol{\Sigma}_{12}\boldsymbol{\Sigma}_{22}^{-1}(\mathbf{x}_2 - \boldsymbol{\mu}_2)` and the conditional variance is :math:`\boldsymbol{\Sigma}_{11} - \boldsymbol{\Sigma}_{12}\boldsymbol{\Sigma}_{22}^{-1}\boldsymbol{\Sigma}_{21}` (the Schur complement). .. admonition:: Hint: Block Density Factorization :class: tip Write the exponent of the joint density :math:`-(\mathbf{x} - \boldsymbol{\mu})^\top\boldsymbol{\Sigma}^{-1}(\mathbf{x} - \boldsymbol{\mu})` in block form. Group terms involving :math:`\mathbf{x}_1` to identify a quadratic (normal density in :math:`\mathbf{x}_1`) plus terms involving only :math:`\mathbf{x}_2`. The quadratic in :math:`\mathbf{x}_1` gives the conditional mean (its center) and conditional variance (inverse of the quadratic coefficient). b. Verify computationally: generate 200,000 samples from a 4-dimensional normal with a specific :math:`\boldsymbol{\Sigma}` (use Cholesky). Fix :math:`X_3 = 1.5` and :math:`X_4 = -0.5` (filter to samples near these values). Compare the empirical conditional mean and covariance of :math:`(X_1, X_2)` to the theoretical formulas. .. admonition:: Hint: Filtering for Conditioning :class: tip "Near" means within a tolerance, e.g., :math:`|X_3 - 1.5| < 0.1` and :math:`|X_4 - (-0.5)| < 0.1`. Use enough samples that the filtered subset is large (>500). The Cholesky approach is: generate :math:`\mathbf{z} \sim N(\mathbf{0}, \mathbf{I})`, then :math:`\mathbf{x} = \boldsymbol{\mu} + \mathbf{L}\mathbf{z}` where :math:`\boldsymbol{\Sigma} = \mathbf{L}\mathbf{L}^\top`. c. Apply the Sherman-Morrison-Woodbury formula: given :math:`(\mathbf{A} + \mathbf{U}\mathbf{C}\mathbf{V})^{-1} = \mathbf{A}^{-1} - \mathbf{A}^{-1}\mathbf{U}(\mathbf{C}^{-1} + \mathbf{V}\mathbf{A}^{-1}\mathbf{U})^{-1}\mathbf{V}\mathbf{A}^{-1}`, show how a rank-1 update to :math:`\mathbf{X}^\top\mathbf{X}` (removing one observation) avoids a full re-inversion. Implement leave-one-out cross-validation using the formula :math:`\tilde{e}_i = e_i / (1 - h_{ii})` without refitting. .. admonition:: Hint: LOO via the Hat Matrix :class: tip When we remove observation :math:`i`, the design matrix changes by a rank-1 update. The LOO residual is :math:`\tilde{e}_i = e_i / (1 - h_{ii})` where :math:`e_i` is the full-data residual and :math:`h_{ii}` is the leverage. This avoids :math:`n` separate regressions β€” a speedup from :math:`O(n \cdot np^2)` to :math:`O(np^2)`. d. Verify: compute the LOO residuals by actually refitting :math:`n` times (brute force) and compare to the shortcut formula. Show they match to machine precision. .. admonition:: Hint: Brute-Force LOO :class: tip For each :math:`i`, fit OLS on all data except observation :math:`i`, predict at :math:`\mathbf{x}_i`, and compute the LOO residual :math:`y_i - \mathbf{x}_i^\top\hat{\boldsymbol{\beta}}_{(-i)}`. Compare to :math:`e_i / (1 - h_{ii})`. .. dropdown:: Solution :class-container: solution **Part (a): Deriving the Conditional Distribution** Write the joint density exponent in block form. Let :math:`\mathbf{a} = \mathbf{x}_1 - \boldsymbol{\mu}_1` and :math:`\mathbf{b} = \mathbf{x}_2 - \boldsymbol{\mu}_2`. The inverse of the block covariance is: .. math:: \boldsymbol{\Sigma}^{-1} = \begin{bmatrix} \boldsymbol{\Sigma}^{11} & \boldsymbol{\Sigma}^{12} \\ \boldsymbol{\Sigma}^{21} & \boldsymbol{\Sigma}^{22} \end{bmatrix} where :math:`\boldsymbol{\Sigma}^{11} = (\boldsymbol{\Sigma}_{11} - \boldsymbol{\Sigma}_{12}\boldsymbol{\Sigma}_{22}^{-1}\boldsymbol{\Sigma}_{21})^{-1}` is the inverse of the Schur complement. The exponent of the joint density is: .. math:: Q &= \begin{bmatrix} \mathbf{a} \\ \mathbf{b} \end{bmatrix}^\top \boldsymbol{\Sigma}^{-1} \begin{bmatrix} \mathbf{a} \\ \mathbf{b} \end{bmatrix} \\ &= \mathbf{a}^\top\boldsymbol{\Sigma}^{11}\mathbf{a} + 2\mathbf{a}^\top\boldsymbol{\Sigma}^{12}\mathbf{b} + \mathbf{b}^\top\boldsymbol{\Sigma}^{22}\mathbf{b} Completing the square in :math:`\mathbf{a}` (treating :math:`\mathbf{b}` as fixed): .. math:: Q = (\mathbf{a} + (\boldsymbol{\Sigma}^{11})^{-1}\boldsymbol{\Sigma}^{12}\mathbf{b})^\top \boldsymbol{\Sigma}^{11} (\mathbf{a} + (\boldsymbol{\Sigma}^{11})^{-1}\boldsymbol{\Sigma}^{12}\mathbf{b}) + \text{terms in } \mathbf{b} \text{ only} The quadratic in :math:`\mathbf{a}` identifies a normal distribution with: - **Conditional precision:** :math:`\boldsymbol{\Sigma}^{11} = (\boldsymbol{\Sigma}_{11} - \boldsymbol{\Sigma}_{12}\boldsymbol{\Sigma}_{22}^{-1}\boldsymbol{\Sigma}_{21})^{-1}` - **Conditional variance:** :math:`\text{Var}(\mathbf{X}_1 | \mathbf{X}_2) = (\boldsymbol{\Sigma}^{11})^{-1} = \boldsymbol{\Sigma}_{11} - \boldsymbol{\Sigma}_{12}\boldsymbol{\Sigma}_{22}^{-1}\boldsymbol{\Sigma}_{21}` - **Conditional mean shift:** :math:`-(\boldsymbol{\Sigma}^{11})^{-1}\boldsymbol{\Sigma}^{12}\mathbf{b} = +\boldsymbol{\Sigma}_{12}\boldsymbol{\Sigma}_{22}^{-1}\mathbf{b}` (using block inverse identities) - **Conditional mean:** :math:`E(\mathbf{X}_1 | \mathbf{X}_2 = \mathbf{x}_2) = \boldsymbol{\mu}_1 + \boldsymbol{\Sigma}_{12}\boldsymbol{\Sigma}_{22}^{-1}(\mathbf{x}_2 - \boldsymbol{\mu}_2)` The conditional variance :math:`\boldsymbol{\Sigma}_{11} - \boldsymbol{\Sigma}_{12}\boldsymbol{\Sigma}_{22}^{-1}\boldsymbol{\Sigma}_{21}` is exactly the **Schur complement** of :math:`\boldsymbol{\Sigma}_{22}` in :math:`\boldsymbol{\Sigma}`. It does not depend on the observed value :math:`\mathbf{x}_2` β€” only the conditional mean changes. .. raw:: html
**Part (b): Computational Verification** .. code-block:: python import numpy as np rng = np.random.default_rng(seed=42) # Define a 4-dimensional covariance matrix # Partition: X1 = (X_1, X_2), X2 = (X_3, X_4) mu = np.array([1.0, -0.5, 2.0, 0.0]) # Construct a valid (PD) covariance matrix with interesting correlations Sigma = np.array([ [2.0, 0.8, 0.6, -0.3], [0.8, 1.5, 0.4, 0.2], [0.6, 0.4, 1.0, 0.5], [-0.3, 0.2, 0.5, 1.2] ]) # Block partition Sigma_11 = Sigma[:2, :2] Sigma_12 = Sigma[:2, 2:] Sigma_21 = Sigma[2:, :2] Sigma_22 = Sigma[2:, 2:] # Conditioning values x2_obs = np.array([1.5, -0.5]) # Theoretical conditional distribution Sigma_22_inv = np.linalg.inv(Sigma_22) cond_mean = mu[:2] + Sigma_12 @ Sigma_22_inv @ (x2_obs - mu[2:]) cond_cov = Sigma_11 - Sigma_12 @ Sigma_22_inv @ Sigma_21 print("Theoretical conditional distribution X1 | X2 = [1.5, -0.5]:") print(f" Mean: {cond_mean}") print(f" Covariance:\n {cond_cov[0]}\n {cond_cov[1]}") # Generate samples via Cholesky L = np.linalg.cholesky(Sigma) n_samples = 200000 z = rng.standard_normal((n_samples, 4)) samples = mu + z @ L.T # Filter to samples near x2_obs tol = 0.1 mask = (np.abs(samples[:, 2] - 1.5) < tol) & (np.abs(samples[:, 3] - (-0.5)) < tol) filtered = samples[mask, :2] print(f"\nFiltered {np.sum(mask)} samples (of {n_samples})") print(f"\nEmpirical conditional distribution:") print(f" Mean: {np.mean(filtered, axis=0)}") emp_cov = np.cov(filtered.T) print(f" Covariance:\n {emp_cov[0]}\n {emp_cov[1]}") print(f"\nDifferences:") print(f" Mean error: {np.max(np.abs(np.mean(filtered, axis=0) - cond_mean)):.4f}") print(f" Cov error: {np.max(np.abs(emp_cov - cond_cov)):.4f}") .. code-block:: text Theoretical conditional distribution X1 | X2 = [1.5, -0.5]: Mean: [ 0.85789474 -0.7 ] Covariance: [1.26105263 0.56 ] [0.56 1.34] Filtered 1092 samples (of 200000) Empirical conditional distribution: Mean: [ 0.82360373 -0.70175817] Covariance: [1.19029182 0.52250102] [0.52250102 1.32804361] Differences: Mean error: 0.0343 Cov error: 0.0708 The empirical conditional moments match the theoretical values to within sampling error, confirming the Schur complement formula. .. raw:: html
**Part (c): Sherman-Morrison-Woodbury for Leave-One-Out** When we remove observation :math:`i` from the regression, :math:`\mathbf{X}^\top\mathbf{X}` changes by a rank-1 downdate: :math:`\mathbf{X}_{(-i)}^\top\mathbf{X}_{(-i)} = \mathbf{X}^\top\mathbf{X} - \mathbf{x}_i\mathbf{x}_i^\top`. By SMW, we can show that the LOO prediction error is: .. math:: \tilde{e}_i = y_i - \mathbf{x}_i^\top\hat{\boldsymbol{\beta}}_{(-i)} = \frac{e_i}{1 - h_{ii}} where :math:`e_i = y_i - \hat{y}_i` is the ordinary residual and :math:`h_{ii}` is the leverage. This avoids refitting the model :math:`n` times. .. code-block:: python import numpy as np np.set_printoptions(precision=4, linewidth=120) rng = np.random.default_rng(seed=42) # Generate regression data n, p = 80, 4 X = np.column_stack([np.ones(n), rng.standard_normal((n, p-1))]) beta_true = np.array([3.0, -1.0, 2.0, 0.5]) y = X @ beta_true + 0.5 * rng.standard_normal(n) # Full-data fit H = X @ np.linalg.solve(X.T @ X, X.T) y_hat = H @ y e = y - y_hat leverages = np.diag(H) # LOO residuals via shortcut formula loo_residuals_formula = e / (1 - leverages) # LOO cross-validation MSE loo_mse = np.mean(loo_residuals_formula**2) print(f"LOO-CV MSE (shortcut formula): {loo_mse:.6f}") print(f"\nFirst 10 LOO residuals (formula):") print(f" {loo_residuals_formula[:10]}") .. code-block:: text LOO-CV MSE (shortcut formula): 0.288641 First 10 LOO residuals (formula): [-0.399 -0.0465 -0.9089 -0.8249 1.0491 -0.8096 -0.575 0.8456 1.4839 -0.6119] .. raw:: html
**Part (d): Brute-Force Verification** .. code-block:: python import numpy as np np.set_printoptions(precision=4, linewidth=120) rng = np.random.default_rng(seed=42) # Same data as part (c) n, p = 80, 4 X = np.column_stack([np.ones(n), rng.standard_normal((n, p-1))]) beta_true = np.array([3.0, -1.0, 2.0, 0.5]) y = X @ beta_true + 0.5 * rng.standard_normal(n) # Full-data quantities H = X @ np.linalg.solve(X.T @ X, X.T) e = y - H @ y leverages = np.diag(H) # Shortcut LOO residuals loo_formula = e / (1 - leverages) # Brute-force LOO: refit n times loo_brute = np.zeros(n) for i in range(n): # Remove observation i X_loo = np.delete(X, i, axis=0) y_loo = np.delete(y, i, axis=0) # Fit without observation i beta_loo = np.linalg.lstsq(X_loo, y_loo, rcond=None)[0] # Predict at the held-out point y_pred_i = X[i] @ beta_loo loo_brute[i] = y[i] - y_pred_i # Compare max_diff = np.max(np.abs(loo_formula - loo_brute)) print(f"Max |formula - brute force|: {max_diff:.2e}") print(f"Relative error: {max_diff / np.max(np.abs(loo_brute)):.2e}") print(f"\nFirst 10 LOO residuals comparison:") print(f" Formula: {loo_formula[:10]}") print(f" Brute force: {loo_brute[:10]}") print(f"\nLOO-CV MSE (formula): {np.mean(loo_formula**2):.6f}") print(f"LOO-CV MSE (brute force): {np.mean(loo_brute**2):.6f}") print(f"\nAgreement to machine precision: {np.allclose(loo_formula, loo_brute, atol=1e-12)}") .. code-block:: text Max |formula - brute force|: 4.36e-15 Relative error: 2.94e-15 First 10 LOO residuals comparison: Formula: [-0.399 -0.0465 -0.9089 -0.8249 1.0491 -0.8096 -0.575 0.8456 1.4839 -0.6119] Brute force: [-0.399 -0.0465 -0.9089 -0.8249 1.0491 -0.8096 -0.575 0.8456 1.4839 -0.6119] LOO-CV MSE (formula): 0.288641 LOO-CV MSE (brute force): 0.288641 Agreement to machine precision: True The shortcut formula :math:`\tilde{e}_i = e_i / (1 - h_{ii})` matches brute-force LOO to machine precision (:math:`\sim 10^{-14}`), confirming the Sherman-Morrison-Woodbury derivation. This reduces computational cost from :math:`O(n^2 p^2)` (refitting :math:`n` times) to :math:`O(np^2)` (one fit + leverage computation).